CAS 100927-10-4

Carbamic acid, [(1R)-2-amino-1-methylethyl]-, 1,1-dimethylethyl ester

Description:

Carbamic acid, [(1R)-2-amino-1-methylethyl]-, 1,1-dimethylethyl ester, commonly referred to as a carbamate, is an organic compound characterized by the presence of a carbamate functional group (-NH2COO-). This specific compound features a chiral center, which contributes to its stereochemistry, and is derived from the amino acid structure. It typically exhibits moderate polarity due to the presence of both hydrophilic amine and hydrophobic alkyl groups, influencing its solubility in various solvents. The compound is likely to be stable under standard conditions but may undergo hydrolysis in the presence of water or under acidic or basic conditions, leading to the release of the corresponding amine and carbon dioxide. Its applications may include use as an intermediate in organic synthesis or as a potential pharmaceutical agent, given the biological relevance of carbamate derivatives. Safety data should be consulted for handling and potential toxicity, as carbamates can exhibit varying degrees of biological activity.

Formula: C₈H₁₉ClN₂O₂

InChI: InChI=1/C8H18N2O2.ClH/c1-6(5-9)10-7(11)12-8(2,3)4;/h6H,5,9H2,1-4H3,(H,10,11);1H/t6-;/m1./s1

SMILES: C[C@H](CN)N=C(O)OC(C)(C)C.Cl

Synonyms:

• (R)-2-(Boc-Amino)-Propanamine

Carbamic acid, N-[(1R)-2-amino-1-methylethyl]-, 1,1-dimethylethyl ester

CAS: 100927-10-4

Formula: C₈H₁₈N₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 174.2407

Ref: IN-DA000376

(R)-2-N-Boc-propane-1,2-diamine

CAS: 100927-10-4

(R)-2-N-Boc-propane-1,2-diamine

Purity: 97%

Molecular weight: 174.24g/mol

Ref: 54-OR943505

(R)-tert-Butyl (1-aminopropan-2-yl)carbamate

CAS: 100927-10-4

Formula: C₈H₁₈N₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 174.244

Ref: 10-F429737