CAS 100937-79-9: 1,5-Anhydro-2-deoxypentitol

Description:1,5-Anhydro-2-deoxypentitol, with the CAS number 100937-79-9, is a sugar alcohol that is structurally related to pentoses. It is characterized by the absence of a hydroxyl group at the C-2 position, which distinguishes it from other pentitols. This compound typically appears as a white crystalline solid and is soluble in water, reflecting its polyol nature. Its molecular structure includes five carbon atoms, with an anhydro configuration that contributes to its stability and unique reactivity. 1,5-Anhydro-2-deoxypentitol is of interest in various biochemical applications, particularly in the study of carbohydrate metabolism and as a potential building block in synthetic organic chemistry. Additionally, it may exhibit properties that are beneficial in food science and pharmaceuticals, such as acting as a sweetener or stabilizer. Its low caloric content and potential health benefits make it a subject of research in nutrition and dietary applications. Overall, this compound represents a fascinating area of study within the field of carbohydrate chemistry.

Formula:C₅H₁₀O₃

InChI:InChI=1S/C5H10O3/c6-4-1-2-8-3-5(4)7/h4-7H,1-3H2

InChI key:InChIKey=PIWMSRFXAJSGLP-UHFFFAOYSA-N

SMILES:OC1COCCC1O