CAS 1010422-67-9: 2-(Cyclobutylmethyl)propanedioic acid

Description:2-(Cyclobutylmethyl)propanedioic acid, identified by its CAS number 1010422-67-9, is an organic compound characterized by the presence of a cyclobutylmethyl group attached to a propanedioic acid backbone. This compound features two carboxylic acid functional groups (-COOH) that contribute to its acidity and reactivity. The cyclobutylmethyl substituent introduces a cyclic structure that can influence the compound's steric and electronic properties, potentially affecting its solubility and interaction with other molecules. The presence of the propanedioic acid moiety suggests that it may participate in various chemical reactions, such as esterification or amidation, making it a candidate for applications in organic synthesis or as a building block in pharmaceuticals. Additionally, the compound's unique structure may impart specific biological activities, although detailed studies would be necessary to elucidate its potential uses in medicinal chemistry or other fields. Overall, 2-(Cyclobutylmethyl)propanedioic acid represents a versatile compound with interesting chemical characteristics.

Formula:C₈H₁₂O₄

InChI:InChI=1S/C8H12O4/c9-7(10)6(8(11)12)4-5-2-1-3-5/h5-6H,1-4H2,(H,9,10)(H,11,12)

InChI key:InChIKey=BEFGISLZPBHJDH-UHFFFAOYSA-N

SMILES:O=C(O)C(C(=O)O)CC1CCC1

Synonyms:
2-Cyclobutylmethyl malonic acid
2-(Cyclobutylmethyl)propanedioic acid
2-(Cyclobutylmethyl)malonic acid
Propanedioic acid, 2-(cyclobutylmethyl)-

Found 3 products.

Product data	Purity	Price range	Estimated delivery
2-(cyclobutylmethyl)malonic acid REF: IN-DA019F1VCAS: 1010422-67-9	95%	To inquire	Tue 04 Mar 25
2-(Cyclobutylmethyl)malonic acid REF: 10-F609691CAS: 1010422-67-9	95%	- - -	Discontinued product
2-(cyclobutylmethyl)propanedioic acid REF: 3D-KQB42267CAS: 1010422-67-9	Min. 95%	- - -	Discontinued product