CAS 101268-36-4: 4-BUTOXY-3-ETHOXY-BENZOIC ACID
Description:4-Butoxy-3-ethoxy-benzoic acid, identified by its CAS number 101268-36-4, is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with butoxy and ethoxy groups. This compound typically exhibits properties associated with both hydrophobic and hydrophilic characteristics due to the presence of the long hydrocarbon chains and the carboxylic acid functional group. It is likely to be a solid at room temperature, with moderate solubility in organic solvents and limited solubility in water, reflecting its amphiphilic nature. The presence of the butoxy and ethoxy groups can influence its reactivity, making it a potential candidate for applications in pharmaceuticals, agrochemicals, or as a surfactant. Additionally, the compound may exhibit specific biological activities, which could be of interest in medicinal chemistry. As with many organic compounds, safety data should be consulted to understand its handling, storage, and potential hazards.
Formula:C13H18O4
InChI:InChI=1/C13H18O4/c1-3-5-8-17-11-7-6-10(13(14)15)9-12(11)16-4-2/h6-7,9H,3-5,8H2,1-2H3,(H,14,15)
- Synonyms:
- 4-Butoxy-3-Ethoxybenzoate
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Benzoic acid, 4-butoxy-3-ethoxy- REF: IN-DA00043SCAS: 101268-36-4 | - - - | To inquire | Thu 27 Mar 25 |
![]() | 4-butoxy-3-ethoxybenzoic acid REF: 10-F367537CAS: 101268-36-4 | - - - | - - - | Discontinued product |
![]() | 4-Butoxy-3-ethoxybenzoic acid REF: 3D-FB119038CAS: 101268-36-4 | Min. 95% | - - - | Discontinued product |

Ref: IN-DA00043S
Undefined size | To inquire |

Ref: 10-F367537
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
2.5g | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |

4-Butoxy-3-ethoxybenzoic acid
Ref: 3D-FB119038
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
5g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |