CAS 101419-78-7: 2-(4-Fluorophenyl)-3-pyridinecarboxylic acid
Description:2-(4-Fluorophenyl)-3-pyridinecarboxylic acid, with the CAS number 101419-78-7, is an organic compound characterized by its aromatic and heterocyclic structure. It features a pyridine ring substituted with a carboxylic acid group and a para-fluorophenyl group, which contributes to its unique chemical properties. This compound typically exhibits moderate solubility in polar solvents due to the presence of the carboxylic acid functional group, while its aromatic nature may enhance its stability and reactivity in various chemical reactions. The fluorine atom in the para position can influence the electronic properties of the molecule, potentially affecting its reactivity and interactions with biological targets. Additionally, compounds of this type may exhibit interesting pharmacological activities, making them of interest in medicinal chemistry. Overall, 2-(4-Fluorophenyl)-3-pyridinecarboxylic acid is a versatile compound with potential applications in drug development and organic synthesis.
Formula:C12H8FNO2
InChI:InChI=1S/C12H8FNO2/c13-9-5-3-8(4-6-9)11-10(12(15)16)2-1-7-14-11/h1-7H,(H,15,16)
InChI key:InChIKey=ACGWDCZWNMSHNE-UHFFFAOYSA-N
SMILES:O=C(O)C1=CC=CN=C1C=2C=CC(F)=CC2
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 3-Pyridinecarboxylic acid, 2-(4-fluorophenyl)- REF: IN-DA0004FTCAS: 101419-78-7 | 95% | To inquire | Thu 27 Mar 25 |
![]() | 2-(4-Fluorophenyl)nicotinic acid REF: 10-F236115CAS: 101419-78-7 | 95.0% | To inquire | Tue 08 Apr 25 |
![]() | 2-(4-Fluorophenyl)nicotinic acid REF: 3D-BEA41978CAS: 101419-78-7 | Min. 95% | - - - | Discontinued product |

3-Pyridinecarboxylic acid, 2-(4-fluorophenyl)-
Ref: IN-DA0004FT
Undefined size | To inquire |

Ref: 10-F236115
1g | To inquire | ||
250mg | To inquire |

2-(4-Fluorophenyl)nicotinic acid
Ref: 3D-BEA41978
1g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |