CAS 101421-72-1: 6-Quinazolinamine

Description:6-Quinazolinamine, with the CAS number 101421-72-1, is an organic compound characterized by its quinazoline structure, which consists of a fused benzene and pyrimidine ring. This compound typically exhibits properties such as being a solid at room temperature and having moderate solubility in polar solvents. It is known for its potential biological activity, particularly in medicinal chemistry, where it may serve as a scaffold for the development of pharmaceuticals. The presence of the amino group in the 6-position of the quinazoline ring can influence its reactivity and interaction with biological targets. Additionally, 6-Quinazolinamine may participate in hydrogen bonding due to its amino group, which can enhance its binding affinity in biological systems. Its derivatives are often explored for their potential applications in treating various diseases, including cancer and infectious diseases, making it a compound of interest in drug discovery and development. As with many chemical substances, safety data and handling precautions should be considered when working with 6-Quinazolinamine.

Formula:C₈H₇N₃

InChI:InChI=1S/C8H7N3/c9-7-1-2-8-6(3-7)4-10-5-11-8/h1-5H,9H2

InChI key:InChIKey=XFGPXURFKAUHQR-UHFFFAOYSA-N

SMILES:N=1C=NC=2C=CC(N)=CC2C1

Synonyms:
6-Aminoquinazoline
6-Quinazolinamine
Quinazolin-6-amine
Quinazolin-6-ylamine
Quinazoline, 6-amino-

Found 4 products.

Product data	Purity	Price range	Estimated delivery
6-Quinazolinamine REF: IN-DA0004GPCAS: 101421-72-1	97%	To inquire	Thu 27 Mar 25
6-Aminoquinazoline REF: 54-OR953083CAS: 101421-72-1	95%	179.00 €~543.00 €	Thu 03 Apr 25
Quinazolin-6-amine REF: 10-F208953CAS: 101421-72-1	95.0%	- - -	Discontinued product
Quinazolin-6-amine REF: 3D-FQ156093CAS: 101421-72-1	Min. 95%	- - -	Discontinued product