CAS 1014632-14-4: 1-(2-Pyrazinyl)-1H-pyrazole-4-carboxylic acid

Description: 1-(2-Pyrazinyl)-1H-pyrazole-4-carboxylic acid is a heterocyclic organic compound characterized by its dual pyrazole and pyrazine rings, which contribute to its unique chemical properties. This compound features a carboxylic acid functional group, enhancing its acidity and potential for forming hydrogen bonds, which can influence its solubility and reactivity. The presence of nitrogen atoms in the pyrazole and pyrazine rings introduces basicity and can facilitate coordination with metal ions, making it of interest in coordination chemistry and potential pharmaceutical applications. The compound's structure allows for various substitution patterns, which can be exploited to modify its biological activity or physical properties. Additionally, its molecular interactions may be significant in biological systems, suggesting potential roles in medicinal chemistry. Overall, 1-(2-Pyrazinyl)-1H-pyrazole-4-carboxylic acid is a versatile compound with applications in research and development, particularly in the fields of drug discovery and materials science.

Formula: C₈H₆N₄O₂

InChI: InChI=1S/C8H6N4O2/c13-8(14)6-3-11-12(5-6)7-4-9-1-2-10-7/h1-5H,(H,13,14)

InChI key: InChIKey=BHIYLFKPRJUWOG-UHFFFAOYSA-N

SMILES: O=C(O)C=1C=NN(C1)C2=NC=CN=C2

Synonyms:

• 1-(2-Pyrazinyl)-1H-pyrazole-4-carboxylic acid
• 1H-Pyrazole-4-carboxylic acid, 1-(2-pyrazinyl)-

1-(Pyrazin-2-yl)-1H-pyrazole-4-carboxylic acid

CAS: 1014632-14-4

• Molecular weight: 190.16g/mol

1-(Pyrazin-2-yl)-1H-pyrazole-4-carboxylic acid

CAS: 1014632-14-4

• Molecular weight: 190.16200256347656

1-(Pyrazin-2-yl)-1H-pyrazole-4-carboxylic acid

CAS: 1014632-14-4

Versatile small molecule scaffold

• Formula: C₈H₆N₄O₂
• Purity: Min. 95%
• Molecular weight: 190.16 g/mol