CAS 1014691-13-4: 4-Methyl-3-(1-methylethoxy)benzoic acid
Description:4-Methyl-3-(1-methylethoxy)benzoic acid, identified by its CAS number 1014691-13-4, is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with a methyl group and an ethoxy group. This compound typically exhibits properties associated with carboxylic acids, such as the ability to form hydrogen bonds, which can influence its solubility and reactivity. The presence of the methyl and ethoxy substituents can affect its physical properties, including melting point, boiling point, and polarity. Generally, compounds like this may be used in various applications, including as intermediates in organic synthesis or in the formulation of specialty chemicals. Its specific reactivity and interactions would depend on the functional groups present, making it relevant in fields such as pharmaceuticals, agrochemicals, and materials science. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper usage and risk management.
Formula:C11H14O3
InChI:InChI=1S/C11H14O3/c1-7(2)14-10-6-9(11(12)13)5-4-8(10)3/h4-7H,1-3H3,(H,12,13)
InChI key:InChIKey=KOSHYQBHZRSYJF-UHFFFAOYSA-N
SMILES:O=C(O)C1=CC=C(C(OC(C)C)=C1)C
- Synonyms:
- 3-Isopropoxy-4-methyl-benzoic acid
- 4-Methyl-3-(1-methylethoxy)benzoic acid
- Benzoic acid, 4-methyl-3-(1-methylethoxy)-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 4-Methyl-3-(1-methylethoxy)benzoic acid REF: IN-DA01DNONCAS: 1014691-13-4 | 95% | To inquire | Thu 27 Mar 25 |
![]() | 4-Methyl-3-(1-methylethoxy)benzoic acid REF: 10-F633196CAS: 1014691-13-4 | 98+% | - - - | Discontinued product |
![]() | 4-Methyl-3-(1-methylethoxy)benzoic acid REF: 3D-PQB69113CAS: 1014691-13-4 | Min. 95% | - - - | Discontinued product |

4-Methyl-3-(1-methylethoxy)benzoic acid
Ref: IN-DA01DNON
1g | 306.00 € | ||
5g | To inquire |

4-Methyl-3-(1-methylethoxy)benzoic acid
Ref: 10-F633196
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information | |
500mg | Discontinued | Request information |

4-Methyl-3-(1-methylethoxy)benzoic acid
Ref: 3D-PQB69113
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information | |
2500mg | Discontinued | Request information |