CAS 1016704-74-7: (3,5-Difluorophenyl)(hexahydro-1H-1,4-diazepin-1-yl)methanone
Description:(3,5-Difluorophenyl)(hexahydro-1H-1,4-diazepin-1-yl)methanone is a chemical compound characterized by its unique structural features, which include a difluorophenyl group and a hexahydro-1H-1,4-diazepin moiety. The presence of fluorine atoms in the phenyl ring enhances the compound's lipophilicity and may influence its biological activity. The hexahydro-1H-1,4-diazepin structure contributes to the compound's potential as a pharmacophore, often associated with various biological activities, including anxiolytic and antidepressant effects. This compound is likely to exhibit moderate to high stability under standard conditions, although specific reactivity can depend on the functional groups present. Its solubility characteristics would typically be influenced by the balance between the hydrophobic phenyl group and the more polar diazepin structure. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of fluorine, which can impart unique toxicological properties. Overall, this compound's structural attributes suggest potential applications in medicinal chemistry and drug development.
Formula:C12H14F2N2O
InChI:InChI=1S/C12H14F2N2O/c13-10-6-9(7-11(14)8-10)12(17)16-4-1-2-15-3-5-16/h6-8,15H,1-5H2
InChI key:InChIKey=RXCBYVKGQFQBHX-UHFFFAOYSA-N
SMILES:O=C(C=1C=C(F)C=C(F)C1)N2CCNCCC2
- Synonyms:
- Methanone, (3,5-difluorophenyl)(hexahydro-1H-1,4-diazepin-1-yl)-
- (3,5-Difluorophenyl)(hexahydro-1H-1,4-diazepin-1-yl)methanone
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 1-(3,5-difluorobenzoyl)-1,4-diazepane REF: 10-F525285CAS: 1016704-74-7 | 95.0% | To inquire | Tue 08 Apr 25 |

1-(3,5-difluorobenzoyl)-1,4-diazepane
Ref: 10-F525285
1g | To inquire | ||
2g | To inquire | ||
5g | To inquire |