CAS 1017778-93-6: 2-Methoxy-6-(trifluoromethyl)benzonitrile
Description:2-Methoxy-6-(trifluoromethyl)benzonitrile is an organic compound characterized by its aromatic structure, which includes a methoxy group (-OCH3) and a trifluoromethyl group (-CF3) attached to a benzene ring. The presence of the nitrile group (-C≡N) indicates that it has a carbon atom triple-bonded to a nitrogen atom, contributing to its reactivity and potential applications in various chemical reactions. This compound is typically a colorless to pale yellow solid and is known for its relatively low solubility in water, while being more soluble in organic solvents. The trifluoromethyl group enhances the compound's lipophilicity and can influence its electronic properties, making it of interest in medicinal chemistry and materials science. Additionally, the methoxy group can participate in hydrogen bonding and may affect the compound's overall polarity. Due to its unique structure, 2-Methoxy-6-(trifluoromethyl)benzonitrile may exhibit interesting biological activities and could be explored for use in pharmaceuticals or agrochemicals.
Formula:C9H6F3NO
InChI:InChI=1S/C9H6F3NO/c1-14-8-4-2-3-7(6(8)5-13)9(10,11)12/h2-4H,1H3
InChI key:InChIKey=OWJIFFRRYYZZTM-UHFFFAOYSA-N
SMILES:N#CC=1C(OC)=CC=CC1C(F)(F)F
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2-Methoxy-6-(trifluoromethyl)benzonitrile REF: 54-PC303044CAS: 1017778-93-6 | 98% | 111.00 €~525.00 € | Fri 28 Mar 25 |
![]() | 2-Methoxy-6-(trifluoromethyl)benzonitrile REF: 10-F342819CAS: 1017778-93-6 | - - - | - - - | Discontinued product |
![]() | 2-Methoxy-6-(trifluoromethyl)benzonitrile REF: 3D-SQB77893CAS: 1017778-93-6 | Min. 95% | - - - | Discontinued product |

2-Methoxy-6-(trifluoromethyl)benzonitrile
Ref: 54-PC303044
1g | 111.00 € | ||
5g | 292.00 € | ||
10g | 525.00 € |

Ref: 10-F342819
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information |

2-Methoxy-6-(trifluoromethyl)benzonitrile
Ref: 3D-SQB77893
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
500mg | Discontinued | Request information |