CAS 1017781-27-9: 3-(3-Bromophenyl)-1-methyl-1H-pyrazol-5-amine
Description:3-(3-Bromophenyl)-1-methyl-1H-pyrazol-5-amine is an organic compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of a bromophenyl group at the 3-position of the pyrazole ring contributes to its unique chemical properties, including potential reactivity and biological activity. The methyl group at the 1-position enhances its lipophilicity, which can influence its solubility and interaction with biological systems. This compound may exhibit various functional properties, making it of interest in medicinal chemistry and drug development. Its structure suggests potential applications in areas such as agrochemicals or pharmaceuticals, particularly in the development of compounds with specific biological activities. The CAS number 1017781-27-9 serves as a unique identifier for this substance, facilitating its identification in chemical databases and literature. Overall, the combination of its structural features may lead to interesting chemical behavior and applications in research and industry.
Formula:C10H10BrN3
InChI:InChI=1S/C10H10BrN3/c1-14-10(12)6-9(13-14)7-3-2-4-8(11)5-7/h2-6H,12H2,1H3
InChI key:InChIKey=WYMMPPWLBLRUNA-UHFFFAOYSA-N
SMILES:BrC1=CC=CC(=C1)C2=NN(C(N)=C2)C
- Synonyms:
- 1H-Pyrazol-5-amine, 3-(3-bromophenyl)-1-methyl-
- 3-(3-Bromophenyl)-1-methyl-1H-pyrazol-5-amine
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 1H-Pyrazol-5-amine, 3-(3-bromophenyl)-1-methyl- REF: IN-DA0005GYCAS: 1017781-27-9 | - - - | To inquire | Thu 27 Mar 25 |
![]() | 5-(3-Bromophenyl)-2-methylpyrazol-3-amine REF: 10-F637488CAS: 1017781-27-9 | 97% | - - - | Discontinued product |
![]() | 5-(3-Bromophenyl)-2-methylpyrazol-3-amine REF: 3D-SQB78127CAS: 1017781-27-9 | Min. 95% | - - - | Discontinued product |

1H-Pyrazol-5-amine, 3-(3-bromophenyl)-1-methyl-
Ref: IN-DA0005GY
Undefined size | To inquire |

5-(3-Bromophenyl)-2-methylpyrazol-3-amine
Ref: 10-F637488
1g | Discontinued | Request information | |
5g | Discontinued | Request information |

5-(3-Bromophenyl)-2-methylpyrazol-3-amine
Ref: 3D-SQB78127
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |