
CAS 10180-02-6: 3-(4-Chlorophenyl)-4,5-dihydro-1,5-diphenyl-1H-pyrazole
Description:3-(4-Chlorophenyl)-4,5-dihydro-1,5-diphenyl-1H-pyrazole, with the CAS number 10180-02-6, is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features a 4-chlorophenyl group and two phenyl groups attached to the pyrazole structure, contributing to its unique properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the chlorophenyl group can influence its reactivity and biological activity, making it of interest in medicinal chemistry and material science. The compound may also display interesting pharmacological properties, potentially acting as an anti-inflammatory or analgesic agent, although specific biological activities would require further investigation. Its synthesis often involves multi-step organic reactions, and it may be analyzed using techniques such as NMR spectroscopy, mass spectrometry, and crystallography to confirm its structure and purity.
Formula:C21H17ClN2
InChI:InChI=1S/C21H17ClN2/c22-18-13-11-16(12-14-18)20-15-21(17-7-3-1-4-8-17)24(23-20)19-9-5-2-6-10-19/h1-14,21H,15H2
InChI key:InChIKey=XTIRIQRCSVUTJZ-UHFFFAOYSA-N
SMILES:ClC=1C=CC(=CC1)C2=NN(C=3C=CC=CC3)C(C=4C=CC=CC4)C2
- Synonyms:
- 2-Pyrazoline, 3-(p-chlorophenyl)-1,5-diphenyl-
- 3-(4-Chlorophenyl)-4,5-dihydro-1,5-diphenyl-1H-pyrazole
- 1,5-Diphenyl-3-(p-chlorophenyl)-2-pyrazoline
- 1H-Pyrazole, 3-(4-chlorophenyl)-4,5-dihydro-1,5-diphenyl-
- 1,5-Diphenyl-3-(p-chlorophenyl)-Δ2-pyrazoline
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 3-(4-Chlorophenyl)-1,5-diphenyl-4,5-dihydro-1H-pyrazole REF: 10-F755951CAS: 10180-02-6 | 90% | - - - | Discontinued product |
![]() | 3-(4-Chlorophenyl)-1,5-diphenyl-4,5-dihydro-1H-pyrazole REF: 3D-KAA18002CAS: 10180-02-6 | Min. 95% | - - - | Discontinued product |

3-(4-Chlorophenyl)-1,5-diphenyl-4,5-dihydro-1H-pyrazole
Ref: 10-F755951
1g | Discontinued | Request information |

3-(4-Chlorophenyl)-1,5-diphenyl-4,5-dihydro-1H-pyrazole
Ref: 3D-KAA18002
5g | Discontinued | Request information | |
10g | Discontinued | Request information |