CAS 1020253-24-0: 5-Chloro-N-cyclohexyl-3-fluoro-2-pyridinamine

Description:5-Chloro-N-cyclohexyl-3-fluoro-2-pyridinamine is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with a chlorine atom at the 5-position and a fluorine atom at the 3-position, along with a cyclohexyl group attached to the nitrogen atom. This compound is typically classified as an amine due to the presence of the amino group (-NH) in its structure. It exhibits properties common to halogenated amines, such as potential reactivity in nucleophilic substitution reactions and the ability to form hydrogen bonds due to the amino group. The presence of both chlorine and fluorine atoms can influence its lipophilicity and biological activity, making it of interest in medicinal chemistry and drug development. Additionally, the cyclohexyl group contributes to its steric properties, which may affect its interaction with biological targets. As with many chemical substances, safety and handling precautions should be observed, as it may pose health risks or environmental hazards.

Formula:C₁₁H₁₄ClFN₂

InChI:InChI=1S/C11H14ClFN2/c12-8-6-10(13)11(14-7-8)15-9-4-2-1-3-5-9/h6-7,9H,1-5H2,(H,14,15)

InChI key:InChIKey=NEAIMLCKTCIVPG-UHFFFAOYSA-N

SMILES:FC1=CC(Cl)=CN=C1NC2CCCCC2

Synonyms:
5-Chloro-N-cyclohexyl-3-fluoro-2-pyridinamine
2-Pyridinamine, 5-chloro-N-cyclohexyl-3-fluoro-

Found 4 products.

Product data	Purity	Price range	Estimated delivery
2-Pyridinamine, 5-chloro-N-cyclohexyl-3-fluoro- REF: IN-DA0006E1CAS: 1020253-24-0	- - -	To inquire	Thu 27 Mar 25
5-Chloro-2-cyclohexylamino-3-fluoropyridine REF: 54-PC445007CAS: 1020253-24-0	- - -	To inquire	Fri 28 Mar 25
5-Chloro-2-cyclohexylamino-3-fluoropyridine REF: 10-F638770CAS: 1020253-24-0	98%	- - -	Discontinued product
5-Chloro-N-cyclohexyl-3-fluoro-2-pyridinamine REF: 3D-FC89555CAS: 1020253-24-0	Min. 95%	- - -	Discontinued product