
CAS 102029-53-8: Guanosine, adenylyl-(3′→5′)-, monoammonium salt
Description:Guanosine, adenylyl-(3′→5′)-, monoammonium salt, commonly referred to as 3',5'-cyclic guanosine monophosphate (cGMP) in its active form, is a nucleotide derivative that plays a crucial role in cellular signaling processes. This compound is characterized by its cyclic structure, which is formed by the linkage of the 3' and 5' phosphate groups of guanosine. The presence of the ammonium salt form indicates that it can exist in a protonated state, which may influence its solubility and reactivity in biological systems. cGMP acts as a secondary messenger in various signaling pathways, particularly in response to nitric oxide and certain hormones, facilitating processes such as vasodilation and neurotransmission. Its stability and reactivity are influenced by environmental factors such as pH and temperature. Additionally, cGMP is involved in regulating various physiological functions, including smooth muscle relaxation and the modulation of ion channels. Understanding the characteristics of this compound is essential for its application in pharmacology and biochemistry.
Formula:C20H25N10O11P·H3N
InChI:InChI=1S/C20H25N10O11P.H3N/c21-14-8-15(24-3-23-14)29(4-25-8)19-12(34)13(6(1-31)39-19)41-42(36,37)38-2-7-10(32)11(33)18(40-7)30-5-26-9-16(30)27-20(22)28-17(9)35;/h3-7,10-13,18-19,31-34H,1-2H2,(H,36,37)(H2,21,23,24)(H3,22,27,28,35);1H3/t6-,7-,10-,11-,12-,13-,18-,19-;/m1./s1
InChI key:InChIKey=PSMXGNLHMFLPGY-VSBWEBIMSA-N
SMILES:O=C1N=C(N)NC2=C1N=CN2C3OC(COP(=O)(O)OC4C(O)C(OC4CO)N5C=NC=6C(=NC=NC65)N)C(O)C3O.N
- Synonyms:
- Guanosine, adenylyl-(3′→5′)-, monoammonium salt
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Adenylyl-(3'-5')-guanosine REF: 3D-NA143918CAS: 102029-53-8 | Min. 95% | To inquire | Mon 07 Apr 25 |
![]() | Adenylyl-3'-5'-guanosine sodium salt REF: 3D-NA46044CAS: 102029-53-8 | Min. 95% | 793.00 €~3,927.00 € | Thu 22 May 25 |

Adenylyl-(3'-5')-guanosine
Ref: 3D-NA143918
Undefined size | To inquire |

Adenylyl-3'-5'-guanosine sodium salt
Ref: 3D-NA46044
1mg | 793.00 € | ||
2mg | 1,453.00 € | ||
5mg | 2,553.00 € | ||
10mg | 3,927.00 € |