CAS 1022128-80-8: 1-(3-Aminophenyl)-2-piperazinone
Description:1-(3-Aminophenyl)-2-piperazinone, identified by its CAS number 1022128-80-8, is a chemical compound that features a piperazinone core substituted with an amino group on a phenyl ring. This compound typically exhibits characteristics common to piperazine derivatives, such as potential biological activity and solubility in polar solvents. The presence of the amino group suggests that it may participate in hydrogen bonding, enhancing its reactivity and interaction with biological targets. The piperazinone structure contributes to its stability and may influence its pharmacokinetic properties. Compounds of this nature are often investigated for their potential therapeutic applications, particularly in the fields of medicinal chemistry and drug development, due to their ability to interact with various biological pathways. Additionally, the compound's molecular structure may allow for modifications that can optimize its efficacy and selectivity in biological systems. As with many organic compounds, safety and handling precautions should be observed, particularly in laboratory settings.
Formula:C10H13N3O
InChI:InChI=1S/C10H13N3O/c11-8-2-1-3-9(6-8)13-5-4-12-7-10(13)14/h1-3,6,12H,4-5,7,11H2
InChI key:InChIKey=PGUYPEBXXBSLCE-UHFFFAOYSA-N
SMILES:O=C1N(C=2C=CC=C(N)C2)CCNC1
- Synonyms:
- 2-Piperazinone, 1-(3-aminophenyl)-
- 1-(3-Aminophenyl)-2-piperazinone
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2-Piperazinone, 1-(3-aminophenyl)- REF: IN-DA0006XWCAS: 1022128-80-8 | 95% | 193.00 € | Thu 27 Mar 25 |
![]() | 1-(3-Aminophenyl)piperazin-2-one REF: 10-F445948CAS: 1022128-80-8 | 95.0% | To inquire | Tue 08 Apr 25 |
![]() | 1-(3-Aminophenyl)piperazin-2-one REF: 3D-XQB12880CAS: 1022128-80-8 | Min. 95% | - - - | Discontinued product |

2-Piperazinone, 1-(3-aminophenyl)-
Ref: IN-DA0006XW
250mg | 193.00 € |

Ref: 10-F445948
250mg | To inquire |

1-(3-Aminophenyl)piperazin-2-one
Ref: 3D-XQB12880
1g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |