CAS 1022128-99-9: 3-Methyl-5-isothiazolesulfonamide
Description:3-Methyl-5-isothiazolesulfonamide is a chemical compound characterized by its isothiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. This compound features a sulfonamide functional group, which is known for its antibacterial properties and is often utilized in pharmaceuticals. The presence of the methyl group at the 3-position of the isothiazole ring can influence its biological activity and solubility. Typically, compounds like 3-Methyl-5-isothiazolesulfonamide exhibit moderate to high polarity due to the sulfonamide group, which can enhance their interaction with biological targets. The compound may also exhibit various biological activities, including antimicrobial and antifungal properties, making it of interest in medicinal chemistry. Its stability, reactivity, and solubility in different solvents can vary based on the specific conditions and the presence of other functional groups. As with many chemical substances, safety data and handling precautions should be considered when working with this compound in laboratory settings.
Formula:C4H6N2O2S2
InChI:InChI=1S/C4H6N2O2S2/c1-3-2-4(9-6-3)10(5,7)8/h2H,1H3,(H2,5,7,8)
InChI key:InChIKey=RLSOEMFZACXWRY-UHFFFAOYSA-N
SMILES:O=S(=O)(N)C=1SN=C(C1)C
- Synonyms:
- 3-Methyl-5-isothiazolesulfonamide
- 5-Isothiazolesulfonamide, 3-methyl-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 5-Isothiazolesulfonamide, 3-methyl- REF: IN-DA0006XSCAS: 1022128-99-9 | - - - | To inquire | Thu 27 Mar 25 |
![]() | 3-Methyl-isothiazole-5-sulphonic acid amide REF: 54-OR346293CAS: 1022128-99-9 | - - - | 374.00 € | Fri 28 Mar 25 |
![]() | 3-Methyl-isothiazole-5-sulfonic acid amide REF: 10-F317533CAS: 1022128-99-9 | 95.0% | - - - | Discontinued product |
![]() | 3-Methyl-isothiazole-5-sulfonamide REF: 3D-XQB12899CAS: 1022128-99-9 | Min. 95% | - - - | Discontinued product |

Ref: IN-DA0006XS
Undefined size | To inquire |

3-Methyl-isothiazole-5-sulphonic acid amide
Ref: 54-OR346293
100mg | 374.00 € |

3-Methyl-isothiazole-5-sulfonic acid amide
Ref: 10-F317533
100mg | Discontinued | Request information | |
500mg | Discontinued | Request information |

3-Methyl-isothiazole-5-sulfonamide
Ref: 3D-XQB12899
1g | Discontinued | Request information | |
10mg | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |