
CAS 1022150-13-5: 4-[4-[2-[[(1,1-Dimethylethoxy)carbonyl]amino]ethyl]-1-piperazinyl]-2-butenoic acid
Description:4-[4-[2-[[(1,1-Dimethylethoxy)carbonyl]amino]ethyl]-1-piperazinyl]-2-butenoic acid, identified by its CAS number 1022150-13-5, is a synthetic organic compound characterized by its complex structure, which includes a piperazine ring and a butenoic acid moiety. This compound features a dimethylethoxycarbonyl group, which contributes to its stability and solubility in organic solvents. The presence of the amino group suggests potential for forming hydrogen bonds, enhancing its reactivity and interaction with biological targets. The butenoic acid component indicates that it may exhibit acidic properties, which could influence its behavior in various chemical environments. This compound is likely to be of interest in pharmaceutical research, particularly in the development of therapeutic agents, due to its structural features that may facilitate interactions with biological macromolecules. Overall, its unique combination of functional groups and structural elements positions it as a potentially valuable compound in medicinal chemistry and related fields.
Formula:C15H27N3O4
InChI:InChI=1S/C15H27N3O4/c1-15(2,3)22-14(21)16-6-8-18-11-9-17(10-12-18)7-4-5-13(19)20/h4-5H,6-12H2,1-3H3,(H,16,21)(H,19,20)
InChI key:InChIKey=XQTIHILHJPULOA-UHFFFAOYSA-N
SMILES:O=C(O)C=CCN1CCN(CCNC(=O)OC(C)(C)C)CC1
- Synonyms:
- 4-[4-[2-[[(1,1-Dimethylethoxy)carbonyl]amino]ethyl]-1-piperazinyl]-2-butenoic acid
- 2-Butenoic acid, 4-[4-[2-[[(1,1-dimethylethoxy)carbonyl]amino]ethyl]-1-piperazinyl]-

2-Butenoic acid, 4-[4-[2-[[(1,1-dimethylethoxy)carbonyl]amino]ethyl]-1-piperazinyl]-
Ref: IN-DA00IM6C
1g | 608.00 € | ||
100mg | 196.00 € | ||
250mg | 323.00 € |

(E)-4-(4-(2-((TERT-BUTOXYCARBONYL)AMINO)ETHYL)PIPERAZIN-1-YL)BUT-2-ENOIC ACID
Ref: 10-F824556
1g | 521.00 € | ||
5g | 1,435.00 € | ||
100mg | 151.00 € | ||
250mg | 277.00 € |

(E)-4-(4-(2-((tert-butoxycarbonyl)amino)ethyl)piperazin-1-yl)but-2-enoic acid
Ref: 3D-XQB15013
1g | Discontinued | Request information | |
500mg | Discontinued | Request information |