CAS 1023814-35-8: 2-Amino-5-methylnicotinaldehyde
Description:2-Amino-5-methylnicotinaldehyde is an organic compound that belongs to the class of nicotinaldehydes, which are derivatives of nicotinic acid. This compound features an amino group (-NH2) and an aldehyde group (-CHO) attached to a pyridine ring, specifically at the 2 and 5 positions, respectively. Its molecular structure contributes to its potential biological activity, making it of interest in medicinal chemistry and drug development. The presence of the amino group allows for hydrogen bonding, which can enhance its solubility in polar solvents. Additionally, the aldehyde functionality can participate in various chemical reactions, such as condensation and reduction, making it a versatile intermediate in organic synthesis. 2-Amino-5-methylnicotinaldehyde may exhibit properties such as fluorescence and can be used in the synthesis of more complex molecules. Its specific applications and reactivity can vary based on the conditions under which it is used, including pH and temperature. As with many chemical substances, safety precautions should be observed when handling this compound.
Formula:C7H8N2O
InChI:InChI=1S/C7H8N2O/c1-5-2-6(4-10)7(8)9-3-5/h2-4H,1H3,(H2,8,9)
- Synonyms:
- 3-Pyridinecarboxaldehyde, 2-amino-5-methyl-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 3-Pyridinecarboxaldehyde, 2-amino-5-methyl- REF: IN-DA0007B5CAS: 1023814-35-8 | 95% | To inquire | Thu 27 Mar 25 |
![]() | 2-Amino-5-methylnicotinaldehyde REF: 54-OR318050CAS: 1023814-35-8 | 95+% | 1,020.00 € | Thu 03 Apr 25 |
![]() | 2-Amino-5-methylnicotinaldehyde REF: 10-F046420CAS: 1023814-35-8 | 95.0% | To inquire | Tue 08 Apr 25 |
![]() | 2-Amino-5-methylnicotinaldehyde REF: 3D-FA141991CAS: 1023814-35-8 | Min. 95% | - - - | Discontinued product |

3-Pyridinecarboxaldehyde, 2-amino-5-methyl-
Ref: IN-DA0007B5
1g | 310.00 € | ||
5g | To inquire | ||
100mg | 119.00 € | ||
250mg | 179.00 € |

Ref: 54-OR318050
1g | 1,020.00 € |

2-Amino-5-methylnicotinaldehyde
Ref: 10-F046420
1g | 609.00 € | ||
2g | To inquire | ||
5g | To inquire | ||
100mg | 201.00 € | ||
250mg | 331.00 € |

2-Amino-5-methylnicotinaldehyde
Ref: 3D-FA141991
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |