CAS 10250-66-5: 3-[(ANILINOCARBONYL)AMINO]PROPANOIC ACID
Description:3-[(Anilinocarbonyl)amino]propanoic acid, with the CAS number 10250-66-5, is an organic compound characterized by its structure, which includes an aniline moiety linked to a propanoic acid backbone through a carbonyl and amino group. This compound typically exhibits properties associated with both amino acids and aromatic amines, including potential solubility in polar solvents due to the presence of the carboxylic acid group. It may participate in various chemical reactions, such as amide formation and coupling reactions, owing to its functional groups. The presence of the aniline group suggests that it may exhibit basic properties and can engage in hydrogen bonding, influencing its reactivity and interactions with other molecules. Additionally, this compound may have applications in pharmaceuticals or as a building block in organic synthesis, given its structural features that allow for further functionalization. Its stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in its handling and application.
Formula:C10H11N2O3
InChI:InChI=1/C10H12N2O3/c13-9(14)6-7-11-10(15)12-8-4-2-1-3-5-8/h1-5H,6-7H2,(H,13,14)(H2,11,12,15)/p-1
- Synonyms:
- N-(phenylcarbamoyl)-beta-alanine
- 3-[(Phenylcarbamoyl)Amino]Propanoate
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | β-Alanine, N-[(phenylamino)carbonyl]- REF: IN-DA0007LBCAS: 10250-66-5 | - - - | To inquire | Thu 27 Mar 25 |
![]() | 3-[(Phenylcarbamoyl)amino]propanoic acid REF: 3D-KAA25066CAS: 10250-66-5 | Min. 95% | To inquire | Thu 08 May 25 |
![]() | 3-[(phenylcarbamoyl)amino]propanoic acid REF: 10-F643869CAS: 10250-66-5 | 97% | - - - | Discontinued product |

Ref: IN-DA0007LB
Undefined size | To inquire |

3-[(Phenylcarbamoyl)amino]propanoic acid
Ref: 3D-KAA25066
5g | 2,500.00 € | ||
500mg | 744.00 € |

Ref: 10-F643869
1g | Discontinued | Request information | |
2.5g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |