CAS 1025700-49-5: 5-Bromo-4-(1-methylethyl)-2-thiazolamine

Description:5-Bromo-4-(1-methylethyl)-2-thiazolamine is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. The presence of a bromine atom at the 5-position and an isopropyl group at the 4-position contributes to its unique reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. This compound is likely to exhibit properties typical of thiazole derivatives, such as antimicrobial and antifungal activities, due to the presence of the thiazole moiety. Additionally, the bromine substituent can enhance the compound's lipophilicity, potentially influencing its bioavailability and interaction with biological targets. The amine functional group may also play a crucial role in its reactivity, allowing for further derivatization or interaction with other chemical entities. Overall, 5-Bromo-4-(1-methylethyl)-2-thiazolamine represents a versatile structure with potential utility in medicinal chemistry and related applications.

Formula:C₆H₉BrN₂S

InChI:InChI=1S/C6H9BrN2S/c1-3(2)4-5(7)10-6(8)9-4/h3H,1-2H3,(H2,8,9)

InChI key:InChIKey=PLPKYAYJIVQOEL-UHFFFAOYSA-N

SMILES:BrC=1SC(=NC1C(C)C)N

Synonyms:
2-Amino-5-bromo-4-isopropylthiazole
(5-Bromo-4-isopropylthiazol-2-yl)amine
5-Bromo-4-(1-methylethyl)-2-thiazolamine
2-Thiazolamine, 5-bromo-4-(1-methylethyl)-

Found 4 products.

Product data	Purity	Price range	Estimated delivery
2-Thiazolamine, 5-bromo-4-(1-methylethyl)- REF: IN-DA0007QTCAS: 1025700-49-5	96%	To inquire	Mon 03 Mar 25
5-Bromo-4-propan-2-yl-1,3-thiazol-2-amine REF: 54-OR91976CAS: 1025700-49-5	98+%	193.00 €	Tue 04 Mar 25
5-Bromo-4-isopropylthiazol-2-amine REF: 10-F092624CAS: 1025700-49-5	95.0%	To inquire	Thu 13 Mar 25
5-Bromo-4-isopropylthiazol-2-amine REF: 3D-FB155071CAS: 1025700-49-5	Min. 95%	- - -	Discontinued product