CAS 10261-82-2: 2-Hydroxy-1,5-naphthyridine
Description:2-Hydroxy-1,5-naphthyridine, with the CAS number 10261-82-2, is a heterocyclic organic compound characterized by a fused bicyclic structure that includes a naphthyridine moiety with a hydroxyl (-OH) group at the 2-position. This compound exhibits properties typical of naphthyridines, such as being a weakly basic aromatic compound due to the presence of nitrogen atoms in the ring structure. The hydroxyl group contributes to its potential as a ligand in coordination chemistry and may enhance its solubility in polar solvents. 2-Hydroxy-1,5-naphthyridine can participate in various chemical reactions, including nucleophilic substitutions and complexation with metal ions. Its structural features suggest potential applications in pharmaceuticals, agrochemicals, and materials science, particularly in the development of biologically active compounds. Additionally, the compound's ability to form hydrogen bonds due to the hydroxyl group may influence its interactions in biological systems. Overall, 2-Hydroxy-1,5-naphthyridine is a versatile compound with significant implications in various fields of chemistry.
Formula:C8H6N2O
InChI:InChI=1/C8H6N2O/c11-8-4-3-6-7(10-8)2-1-5-9-6/h1-5H,(H,10,11)
- Synonyms:
- 1,5-Naphthyridin-2(1H)-one
- 1,5-Naphthyridin-2-Ol
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2-Hydroxy-1,5-naphthyridine REF: IN-DA0007WTCAS: 10261-82-2 | 97% | 53.00 €~508.00 € | Thu 27 Mar 25 |
![]() | 1,5-Naphthyridin-2(1H)-one REF: 54-OR901584CAS: 10261-82-2 | 0.97 | 32.00 €~2,065.00 € | Fri 28 Mar 25 |
![]() | 1,5-Naphthyridin-2(1H)-one REF: 10-F220059CAS: 10261-82-2 | 95.0% | To inquire | Tue 08 Apr 25 |
![]() | 2-Hydroxy-1,5-naphthyridine REF: 3D-FH146949CAS: 10261-82-2 | Min. 95% | - - - | Discontinued product |

2-Hydroxy-1,5-naphthyridine
Ref: IN-DA0007WT
1g | 155.00 € | ||
100mg | 53.00 € | ||
250mg | 70.00 € |

Ref: 54-OR901584
1g | 125.00 € | ||
5g | 475.00 € | ||
25g | 2,065.00 € | ||
100mg | 32.00 € | ||
250mg | 52.00 € |

1,5-Naphthyridin-2(1H)-one
Ref: 10-F220059
1g | 117.00 € | ||
5g | 420.00 € |

2-Hydroxy-1,5-naphthyridine
Ref: 3D-FH146949
5mg | Discontinued | Request information | |
10mg | Discontinued | Request information | |
25mg | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information |