CAS 1027511-94-9: 1-Acetylhexahydro-1H-azepine-4-carboxylic acid
Description:1-Acetylhexahydro-1H-azepine-4-carboxylic acid is a chemical compound characterized by its unique bicyclic structure, which includes a hexahydroazepine ring and a carboxylic acid functional group. This compound typically exhibits properties associated with both amines and carboxylic acids, such as potential solubility in polar solvents and the ability to participate in acid-base reactions. The presence of the acetyl group contributes to its reactivity, allowing for various chemical transformations. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological systems. Additionally, the compound may exhibit specific stereochemical configurations, influencing its biological activity and interactions. As with many organic compounds, its stability, reactivity, and solubility can be influenced by environmental factors such as pH and temperature. Overall, 1-Acetylhexahydro-1H-azepine-4-carboxylic acid represents a versatile structure with potential utility in various chemical and pharmaceutical applications.
Formula:C9H15NO3
InChI:InChI=1S/C9H15NO3/c1-7(11)10-5-2-3-8(4-6-10)9(12)13/h8H,2-6H2,1H3,(H,12,13)
InChI key:InChIKey=GJGQKGPMFOLMPB-UHFFFAOYSA-N
SMILES:O=C(O)C1CCN(C(=O)C)CCC1
- Synonyms:
- 1-Acetylhexahydro-1H-azepine-4-carboxylic acid
- 1H-Azepine-4-carboxylic acid, 1-acetylhexahydro-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 1H-Azepine-4-carboxylic acid, 1-acetylhexahydro- REF: IN-DA0008AACAS: 1027511-94-9 | - - - | To inquire | Thu 27 Mar 25 |
![]() | 1-Acetylazepane-4-carboxylic acid REF: 10-F036637CAS: 1027511-94-9 | 97.0% | - - - | Discontinued product |
![]() | 1-Acetylazepane-4-carboxylic acid REF: 3D-CRB51194CAS: 1027511-94-9 | Min. 95% | - - - | Discontinued product |

1H-Azepine-4-carboxylic acid, 1-acetylhexahydro-
Ref: IN-DA0008AA
Undefined size | To inquire |

Ref: 10-F036637
1g | Discontinued | Request information | |
250mg | Discontinued | Request information |

1-Acetylazepane-4-carboxylic acid
Ref: 3D-CRB51194
1g | Discontinued | Request information | |
10mg | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |