Product correctly added to cart.

1-Acetylhexahydro-1H-azepine-4-carboxylic acid

CAS 1027511-94-9: 1-Acetylhexahydro-1H-azepine-4-carboxylic acid

Description:1-Acetylhexahydro-1H-azepine-4-carboxylic acid is a chemical compound characterized by its unique bicyclic structure, which includes a hexahydroazepine ring and a carboxylic acid functional group. This compound typically exhibits properties associated with both amines and carboxylic acids, such as potential solubility in polar solvents and the ability to participate in acid-base reactions. The presence of the acetyl group contributes to its reactivity, allowing for various chemical transformations. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological systems. Additionally, the compound may exhibit specific stereochemical configurations, influencing its biological activity and interactions. As with many organic compounds, its stability, reactivity, and solubility can be influenced by environmental factors such as pH and temperature. Overall, 1-Acetylhexahydro-1H-azepine-4-carboxylic acid represents a versatile structure with potential utility in various chemical and pharmaceutical applications.

Formula:C9H15NO3

InChI:InChI=1S/C9H15NO3/c1-7(11)10-5-2-3-8(4-6-10)9(12)13/h8H,2-6H2,1H3,(H,12,13)

InChI key:InChIKey=GJGQKGPMFOLMPB-UHFFFAOYSA-N

SMILES:O=C(O)C1CCN(C(=O)C)CCC1

  • Synonyms:
  • 1-Acetylhexahydro-1H-azepine-4-carboxylic acid
  • 1H-Azepine-4-carboxylic acid, 1-acetylhexahydro-
Sort by


See more categories

This search does not contain any category.

Found 3 products.

discount label

1H-Azepine-4-carboxylic acid, 1-acetylhexahydro-

CAS:1027511-94-9

Ref: IN-DA0008AA

Undefined sizeTo inquire
Estimated delivery in United States, on Thursday 27 Mar 2025
discount label

1-Acetylazepane-4-carboxylic acid

CAS:1027511-94-9

Discontinued product
discount label

1-Acetylazepane-4-carboxylic acid

CAS:1027511-94-9

Ref: 3D-CRB51194

1gDiscontinuedRequest information
10mgDiscontinuedRequest information
50mgDiscontinuedRequest information
100mgDiscontinuedRequest information
250mgDiscontinuedRequest information
500mgDiscontinuedRequest information
Discontinued product
Welcome to CymitQuimica!We use cookies to enhance your visit. We do not include advertising.

Please see our Cookies Policy for more details or adjust your preferences in "Settings".