CAS 102771-12-0: Nerisopam

Description:Nerisopam, identified by the CAS number 102771-12-0, is a chemical compound that belongs to the class of benzodiazepines. It is primarily recognized for its anxiolytic and sedative properties, making it useful in the treatment of anxiety disorders and related conditions. The compound exhibits a mechanism of action that involves the modulation of gamma-aminobutyric acid (GABA) receptors in the central nervous system, leading to increased inhibitory neurotransmission. Nerisopam is characterized by its relatively high lipophilicity, which influences its absorption and distribution within the body. Additionally, it may have a favorable pharmacokinetic profile, including a moderate half-life, which can affect dosing regimens. As with other benzodiazepines, potential side effects may include sedation, dizziness, and dependence with prolonged use. Due to its pharmacological effects, Nerisopam is typically prescribed with caution, and its use is monitored to mitigate risks associated with benzodiazepine therapy.

Formula:C₁₈H₁₉N₃O₂

InChI:InChI=1S/C18H19N3O2/c1-11-8-13-9-16(22-2)17(23-3)10-15(13)18(21-20-11)12-4-6-14(19)7-5-12/h4-7,9-10H,8,19H2,1-3H3

InChI key:InChIKey=WWQDEXGFYVSTCX-UHFFFAOYSA-N

SMILES:N=1N=C(C)CC=2C=C(OC)C(OC)=CC2C1C=3C=CC(N)=CC3