CAS 102872-33-3: 3-(3-Hydroxyphenyl)-Dl-Beta-Alanine
Description:3-(3-Hydroxyphenyl)-Dl-Beta-Alanine, with the CAS number 102872-33-3, is an amino acid derivative characterized by the presence of a hydroxyl group on a phenyl ring, which is attached to a beta-alanine backbone. This compound exhibits both hydrophilic and hydrophobic properties due to its structural components, making it potentially useful in various biochemical applications. The hydroxyl group can participate in hydrogen bonding, enhancing its solubility in polar solvents. Additionally, the presence of the amino and carboxylic acid functional groups allows it to engage in typical amino acid reactions, such as peptide bond formation. This compound may also exhibit antioxidant properties due to the phenolic structure, which can scavenge free radicals. Its unique structure suggests potential roles in pharmaceuticals, particularly in the development of neuroprotective agents or as a supplement in sports nutrition. However, further studies are necessary to fully elucidate its biological activities and therapeutic potential.
Formula:C9H11NO3
InChI:InChI=1/C9H11NO3/c10-8(5-9(12)13)6-2-1-3-7(11)4-6/h1-4,8,11H,5,10H2,(H,12,13)
- Synonyms:
- 3-Amino-3-(3-hydroxyphenyl)propanoic acid
- Benzenepropanoic acid, beta-amino-3-hydroxy-
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | Benzenepropanoic acid, β-amino-3-hydroxy- REF: IN-DA002RI4CAS: 102872-33-3 | 97% | To inquire | Tue 04 Mar 25 |
 | 3-Amino-3-(3-hydroxyphenyl)propanoic acid REF: 54-OR13244CAS: 102872-33-3 | By hplc: 97.3% by area (Typical Value in Batch COA) | 60.00 €~384.00 € | Mon 03 Mar 25 |
 | DL-ß-(3-Hydroxyphenyl)alanine REF: 10-F034442CAS: 102872-33-3 | 97.0% | To inquire | Wed 12 Mar 25 |
| 3-Amino-3-(3-hydroxyphenyl)propanoic acid REF: 10-F765454CAS: 102872-33-3 | 98% | - - - | Discontinued product |
 | 3-Amino-3-(3-hydroxyphenyl)propanoic acid REF: 3D-FA117549CAS: 102872-33-3 | Min. 95% | - - - | Discontinued product |
Benzenepropanoic acid, β-amino-3-hydroxy-
Ref: IN-DA002RI4
| 1g | 251.00 € | ||
| 5g | To inquire | ||
| 25g | To inquire |
3-Amino-3-(3-hydroxyphenyl)propanoic acid
Ref: 54-OR13244
| 1g | 60.00 € | ||
| 5g | 216.00 € | ||
| 10g | 384.00 € |
Ref: 10-F034442
| 1g | To inquire | ||
| 5g | To inquire | ||
| 10g | To inquire |
3-Amino-3-(3-hydroxyphenyl)propanoic acid
Ref: 10-F765454
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information |
3-Amino-3-(3-hydroxyphenyl)propanoic acid
Ref: 3D-FA117549
| 1g | Discontinued | Request information | |
| 2g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
