CAS 10315-03-4: 4-Acetyl-4-phenylpiperidine hydrochloride
Description:4-Acetyl-4-phenylpiperidine hydrochloride is a chemical compound characterized by its piperidine structure, which includes a six-membered ring containing one nitrogen atom. This compound features an acetyl group and a phenyl group attached to the piperidine ring, contributing to its unique properties. It is typically encountered as a hydrochloride salt, which enhances its solubility in water and makes it suitable for various applications in research and pharmaceuticals. The compound is known for its potential use in medicinal chemistry, particularly in the development of analgesics and other therapeutic agents. Its molecular structure allows for interactions with biological targets, making it of interest in pharmacological studies. As with many chemical substances, safety precautions should be observed when handling it, as it may pose health risks if ingested or improperly managed. Overall, 4-Acetyl-4-phenylpiperidine hydrochloride exemplifies the complexity and utility of organic compounds in scientific research.
Formula:C13H17NO·ClH
InChI:InChI=1S/C13H17NO.ClH/c1-11(15)13(7-9-14-10-8-13)12-5-3-2-4-6-12;/h2-6,14H,7-10H2,1H3;1H
InChI key:InChIKey=JYDHZOIDIWUHDB-UHFFFAOYSA-N
SMILES:Cl.O=C(C)C1(C=2C=CC=CC2)CCNCC1
- Synonyms:
- Ethanone, 1-(4-phenyl-4-piperidinyl)-, hydrochloride
- Ketone, methyl 4-phenyl-4-piperidyl, hydrochloride
- Ethanone, 1-(4-phenyl-4-piperidinyl)-, hydrochloride (1:1)
- 1-(4-Phenylpiperidin-4-yl)ethan-1-one hydrochloride
- 4-Acetyl-4-phenylpiperidine hydrochloride

4-Acetyl-4-phenylpiperidine Hydrochloride
Ref: 3B-A1570
5g | 191.00 € |

4-ACETYL-4-PHENYLPIPERIDINE HYDROCHLORIDE
Ref: IN-DA003KMM
250mg | 51.00 € |

4-Acetyl-4-phenylpiperidine hydrochloride, 99%
Ref: AC-13458
5g | 165.00 € |

1-(4-Phenylpiperidin-4-yl)ethanone hydrochloride
Ref: 10-F068911
5g | 364.00 € |

4-Acetyl-4-phenylpiperidine Hydrochloride
Ref: 3D-KAA31503
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information | |
50g | Discontinued | Request information |