CAS 103335-41-7: Methyl 3-oxo-4-aza-5α-androst-1-ene-17β-carboxylate
Description:Methyl 3-oxo-4-aza-5α-androst-1-ene-17β-carboxylate, with the CAS number 103335-41-7, is a synthetic steroid derivative characterized by its unique structural features, including a nitrogen atom in the steroid framework, which classifies it as an aza-steroid. This compound typically exhibits a steroid-like core structure, which is essential for its biological activity. The presence of the 3-oxo group indicates a ketone functionality, while the 17β-carboxylate moiety suggests potential for esterification and reactivity in various chemical environments. Methyl esters are often more lipophilic, enhancing their bioavailability. The compound may possess hormonal activity, potentially interacting with steroid receptors, which is a common characteristic of many steroid derivatives. Its synthesis and modification can lead to various analogs with differing pharmacological properties. As with many synthetic steroids, it is important to handle this compound with care, considering its potential biological effects and regulatory status in various jurisdictions.
Formula:C20H29NO3
InChI:InChI=1S/C20H29NO3/c1-19-10-8-14-12(13(19)5-6-15(19)18(23)24-3)4-7-16-20(14,2)11-9-17(22)21-16/h9,11-16H,4-8,10H2,1-3H3,(H,21,22)/t12-,13-,14-,15+,16+,19-,20+/m0/s1
InChI key:InChIKey=WMSQGMYJYBSBKA-ALHYADCGSA-N
SMILES:O=C1C=CC2(C)C(N1)CCC3C2CCC4(C)C(C(=O)OC)CCC34
- Synonyms:
- 17β-(Methoxycarbonyl)-4-aza-5α-androst-1-en-3-one
- 1H-Indeno[5,4-f]quinoline-7-carboxylic acid, 1,4a,4b,5,6,6a,7,8,9,9a,9b,10,11,11a-tetradecahydro-4a,6a-dimethyl-2-oxo-, methyl ester, [4aR-(4aα,4bβ,6aα,7α,9aβ,9bα,11aβ)]-
- 1H-Indeno[5,4-f]quinoline-7-carboxylic acid, 2,4a,4b,5,6,6a,7,8,9,9a,9b,10,11,11a-tetradecahydro-4a,6a-dimethyl-2-oxo-, methyl ester, (4aR,4bS,6aS,7S,9aS,9bS,11aR)-
- 3-Oxo-4-aza-5α-androst-1-en-17β-carboxylic acid methyl ester
- 4-Azaandrost-1-ene-17-carboxylic acid, 3-oxo-, methyl ester, (5α,17β)-
- Methyl 3-Oxo-4-Aza-5-Alpha-Androst-1-Ene-17-Beta-Carboxylate
- Methyl 3-oxo-4-aza-5α-androst-1-ene-17β-carboxylate
- methyl (4aR,4bS,6aS,7S,9aS,9bS,11aR)-4a,6a-dimethyl-2-oxo-2,4a,4b,5,6,6a,7,8,9,9a,9b,10,11,11a-tetradecahydro-1H-indeno[5,4-f]quinoline-7-carboxylate
