CAS 1033693-14-9: 2-Propyl-5-pyrimidinecarbonitrile

Description:2-Propyl-5-pyrimidinecarbonitrile is an organic compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms at positions 1 and 3. The presence of a propyl group at the 2-position and a cyano group (-C≡N) at the 5-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents due to the polar nature of the cyano group. Its molecular structure suggests potential applications in pharmaceuticals or agrochemicals, as pyrimidine derivatives are often found in biologically active compounds. The presence of the cyano group can also influence its reactivity, making it a potential candidate for further chemical modifications. Additionally, the compound's stability and reactivity can be affected by environmental factors such as temperature and pH. As with many organic compounds, safety data should be consulted to understand any hazards associated with handling and usage.

Formula:C₈H₉N₃

InChI:InChI=1S/C8H9N3/c1-2-3-8-10-5-7(4-9)6-11-8/h5-6H,2-3H2,1H3

InChI key:InChIKey=KDVJXXVGCAXALB-UHFFFAOYSA-N

SMILES:N#CC1=CN=C(N=C1)CCC

Synonyms:
2-Propyl-5-pyrimidinecarbonitrile
5-Pyrimidinecarbonitrile, 2-propyl-

Found 3 products.

Product data	Purity	Price range	Estimated delivery
2-propyl-5-pyrimidinecarbonitrile REF: IN-DA00J1X4CAS: 1033693-14-9	- - -	To inquire	Wed 05 Mar 25
2-propyl-5-pyrimidinecarbonitrile REF: 10-F311185CAS: 1033693-14-9	95.0%	To inquire	Mon 17 Mar 25
2-Propyl-5-pyrimidinecarbonitrile REF: 3D-IRB69314CAS: 1033693-14-9	Min. 95%	- - -	Discontinued product