CAS 103418-56-0: 5-(2-FURYL)-1,3,4-OXADIAZOL-2(3H)-ONE
Description:5-(2-Furyl)-1,3,4-oxadiazol-2(3H)-one is a heterocyclic compound characterized by the presence of a five-membered oxadiazole ring fused with a furyl group. This compound typically exhibits a white to off-white crystalline appearance. The oxadiazole moiety contributes to its potential biological activity, as such compounds are often investigated for their pharmacological properties, including antimicrobial and anti-inflammatory effects. The furyl substituent can enhance the compound's lipophilicity, potentially influencing its bioavailability and interaction with biological targets. The presence of the oxadiazole ring also suggests the possibility of tautomerism, which can affect its reactivity and stability. Additionally, this compound may exhibit fluorescence properties, making it of interest in various applications, including materials science and medicinal chemistry. Its specific reactivity and interactions would depend on the functional groups present and the overall molecular structure, making it a subject of interest for further research in synthetic and medicinal chemistry.
Formula:C6H4N2O3
InChI:InChI=1/C6H4N2O3/c9-6-8-7-5(11-6)4-2-1-3-10-4/h1-3H,(H,8,9)
- Synonyms:
- 5-(furan-2-yl)-1,3,4-oxadiazol-2(3H)-one
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 5-(Furan-2-yl)-2,3-dihydro-1,3,4-oxadiazol-2-one REF: 3D-DEA41856CAS: 103418-56-0 | Min. 95% | To inquire | Thu 08 May 25 |
![]() | 5-(Furan-2-yl)-2,3-dihydro-1,3,4-oxadiazol-2-one REF: 10-F657582CAS: 103418-56-0 | 97% | - - - | Discontinued product |

5-(Furan-2-yl)-2,3-dihydro-1,3,4-oxadiazol-2-one
Ref: 3D-DEA41856
250mg | 500.00 € | ||
2500mg | 1,786.00 € |

5-(Furan-2-yl)-2,3-dihydro-1,3,4-oxadiazol-2-one
Ref: 10-F657582
1g | Discontinued | Request information | |
2.5g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |