CAS 1035655-10-7: (4S,4aS,5aR,12aS)-4-(Dimethylamino)-7-formyl-1,4,4a,5,5a,6,11,12a-octahydro-3,10,12,12a-tetrahydroxy-1,11-dioxo-2-naphthacenecarboxamide

Description:The chemical substance with the name "(4S,4aS,5aR,12aS)-4-(Dimethylamino)-7-formyl-1,4,4a,5,5a,6,11,12a-octahydro-3,10,12,12a-tetrahydroxy-1,11-dioxo-2-naphthacenecarboxamide" and CAS number "1035655-10-7" is a complex organic compound characterized by its multi-ring structure, which includes a naphthalene moiety. This compound features multiple functional groups, including a dimethylamino group, aldehyde, hydroxyl groups, and a carboxamide, contributing to its potential biological activity. The stereochemistry indicated by the specific configuration at various chiral centers suggests that the compound may exhibit unique interactions in biological systems, possibly influencing its pharmacological properties. The presence of dioxo and tetrahydroxy functionalities may enhance its reactivity and solubility in various solvents. Overall, this compound's intricate structure and functional groups suggest potential applications in medicinal chemistry, although further studies would be necessary to elucidate its specific properties and biological effects.

Formula:C₂₂H₂₂N₂O₈

InChI:InChI=1S/C22H22N2O8/c1-24(2)16-11-6-9-5-10-8(7-25)3-4-12(26)14(10)17(27)13(9)19(29)22(11,32)20(30)15(18(16)28)21(23)31/h3-4,7,9,11,16,26,28-29,32H,5-6H2,1-2H3,(H2,23,31)/t9-,11-,16-,22-/m0/s1

InChI key:InChIKey=IMNBEGYSZUPVOP-YFXODTNBSA-N

SMILES:O=CC1=CC=C(O)C=2C(=O)C3=C(O)C4(O)C(=O)C(C(=O)N)=C(O)C(N(C)C)C4CC3CC12

Synonyms:
2-Naphthacenecarboxamide, 4-(dimethylamino)-7-formyl-1,4,4a,5,5a,6,11,12a-octahydro-3,10,12,12a-tetrahydroxy-1,11-dioxo-, (4S,4aS,5aR,12aS)-
(4S,4aS,5aR,12aS)-4-(Dimethylamino)-7-formyl-1,4,4a,5,5a,6,11,12a-octahydro-3,10,12,12a-tetrahydroxy-1,11-dioxo-2-naphthacenecarboxamide