CAS 103566-21-8: 5-(acetylamino)-1-benzothiophene-2-carboxylic acid

Description: 5-(Acetylamino)-1-benzothiophene-2-carboxylic acid is a chemical compound characterized by its unique structure, which includes a benzothiophene core, an acetylamino group, and a carboxylic acid functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. The presence of the acetylamino group suggests that it may participate in various chemical reactions, such as acylation or amidation, while the carboxylic acid group can engage in hydrogen bonding and act as a site for further functionalization. The benzothiophene moiety often imparts interesting electronic properties, making it a subject of interest in medicinal chemistry and materials science. Additionally, the compound may exhibit solubility in organic solvents and varying degrees of stability depending on environmental conditions. Its specific applications and reactivity can be influenced by the functional groups present, making it a versatile compound for research and development in various chemical fields.

Formula: C₁₁H₉NO₃S

InChI: InChI=1/C11H9NO3S/c1-6(13)12-8-2-3-9-7(4-8)5-10(16-9)11(14)15/h2-5H,1H3,(H,12,13)(H,14,15)

Synonyms:

• 5-Acetamido-1-benzothiophene-2-carboxylic acid
• Benzo[B]Thiophene-2-Carboxylic Acid, 5-(Acetylamino)-

5-Acetamidobenzo[b]thiophene-2-carboxylic acid

CAS: 103566-21-8

• Purity: 95+%
• Molecular weight: 235.25999450683594

5-Acetamidobenzothiophene-2-carboxylic acid

CAS: 103566-21-8

Versatile small molecule scaffold

• Formula: C₁₁H₉NO₃S
• Purity: Min. 95%
• Molecular weight: 235.26 g/mol