CAS 10371-48-9: 4,6-Dichloro-N-ethyl-2-pyrimidinamine

Description:4,6-Dichloro-N-ethyl-2-pyrimidinamine is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at the 1 and 3 positions. The presence of two chlorine atoms at the 4 and 6 positions of the pyrimidine ring contributes to its reactivity and potential applications in various chemical reactions. The N-ethyl group indicates that an ethyl substituent is attached to the nitrogen atom, influencing the compound's solubility and biological activity. This compound is often studied for its potential use in pharmaceuticals, particularly as an intermediate in the synthesis of other biologically active molecules. Its properties, such as melting point, boiling point, and solubility, can vary based on environmental conditions and the presence of other functional groups. Safety data should be consulted, as halogenated compounds can exhibit toxicity and environmental persistence. Overall, 4,6-Dichloro-N-ethyl-2-pyrimidinamine is of interest in both synthetic and medicinal chemistry contexts.

Formula:C₆H₇Cl₂N₃

InChI:InChI=1S/C6H7Cl2N3/c1-2-9-6-10-4(7)3-5(8)11-6/h3H,2H2,1H3,(H,9,10,11)

InChI key:InChIKey=JDWUPHRMFWCUBA-UHFFFAOYSA-N

SMILES:ClC=1N=C(N=C(Cl)C1)NCC

Synonyms:
4,6-Dichloro-2-(ethylamino)pyrimidine
2-Pyrimidinamine, 4,6-dichloro-N-ethyl-
4,6-Dichloro-N-ethyl-2-pyrimidinamine
Pyrimidine, 4,6-dichloro-2-(ethylamino)-
(4,6-Dichloropyrimidin-2-yl)-ethylamine

Found 3 products.

Product data	Purity	Price range	Estimated delivery
4,6-Dichloro-N-ethylpyrimidin-2-amine REF: IN-DA007FUICAS: 10371-48-9	- - -	To inquire	Tue 11 Mar 25
(4,6-Dichloro-pyrimidin-2-yl)-ethyl-amine REF: 10-F038237CAS: 10371-48-9	95.0%	- - -	Discontinued product
4,6-Dichloro-N-ethylpyrimidin-2-amine REF: 3D-KAA37148CAS: 10371-48-9	Min. 95%	- - -	Discontinued product