CAS 10371-48-9: 4,6-Dichloro-N-ethyl-2-pyrimidinamine
Description:4,6-Dichloro-N-ethyl-2-pyrimidinamine is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at the 1 and 3 positions. The presence of two chlorine atoms at the 4 and 6 positions of the pyrimidine ring contributes to its reactivity and potential applications in various chemical reactions. The N-ethyl group indicates that an ethyl substituent is attached to the nitrogen atom, influencing the compound's solubility and biological activity. This compound is often studied for its potential use in pharmaceuticals, particularly as an intermediate in the synthesis of other biologically active molecules. Its properties, such as melting point, boiling point, and solubility, can vary based on environmental conditions and the presence of other functional groups. Safety data should be consulted, as halogenated compounds can exhibit toxicity and environmental persistence. Overall, 4,6-Dichloro-N-ethyl-2-pyrimidinamine is of interest in both synthetic and medicinal chemistry contexts.
Formula:C6H7Cl2N3
InChI:InChI=1S/C6H7Cl2N3/c1-2-9-6-10-4(7)3-5(8)11-6/h3H,2H2,1H3,(H,9,10,11)
InChI key:InChIKey=JDWUPHRMFWCUBA-UHFFFAOYSA-N
SMILES:ClC=1N=C(N=C(Cl)C1)NCC
- Synonyms:
- 4,6-Dichloro-2-(ethylamino)pyrimidine
- 2-Pyrimidinamine, 4,6-dichloro-N-ethyl-
- 4,6-Dichloro-N-ethyl-2-pyrimidinamine
- Pyrimidine, 4,6-dichloro-2-(ethylamino)-
- (4,6-Dichloropyrimidin-2-yl)-ethylamine
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 4,6-Dichloro-N-ethylpyrimidin-2-amine REF: IN-DA007FUICAS: 10371-48-9 | - - - | To inquire | Thu 27 Mar 25 |
![]() | (4,6-Dichloro-pyrimidin-2-yl)-ethyl-amine REF: 10-F038237CAS: 10371-48-9 | 95.0% | - - - | Discontinued product |
![]() | 4,6-Dichloro-N-ethylpyrimidin-2-amine REF: 3D-KAA37148CAS: 10371-48-9 | Min. 95% | - - - | Discontinued product |

Ref: IN-DA007FUI
Undefined size | To inquire |

(4,6-Dichloro-pyrimidin-2-yl)-ethyl-amine
Ref: 10-F038237
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
250mg | Discontinued | Request information |

4,6-Dichloro-N-ethylpyrimidin-2-amine
Ref: 3D-KAA37148
250mg | Discontinued | Request information | |
2500mg | Discontinued | Request information |