CAS 103741-08-8: [4-(1,3-dioxolan-2-yl)phenyl]-phenyl-methanone
Description:The chemical substance known as [4-(1,3-dioxolan-2-yl)phenyl]-phenyl-methanone, with the CAS number 103741-08-8, is an organic compound characterized by its complex structure, which includes a phenyl group and a dioxolane ring. This compound typically exhibits properties associated with ketones, such as being a potential electrophile due to the carbonyl group. The presence of the dioxolane moiety may impart unique solubility characteristics and reactivity, making it of interest in various chemical applications, including organic synthesis and materials science. Additionally, the compound may exhibit specific optical properties, which can be influenced by its molecular structure. Its stability, reactivity, and potential applications in fields such as pharmaceuticals or photochemistry would depend on the specific conditions under which it is used. As with many organic compounds, safety data sheets should be consulted for handling and storage guidelines, as well as potential hazards associated with its use.
Formula:C16H14O3
InChI:InChI=1/C16H14O3/c17-15(12-4-2-1-3-5-12)13-6-8-14(9-7-13)16-18-10-11-19-16/h1-9,16H,10-11H2
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 4-(1,3-Dioxolan-2-yl)benzophenone REF: 10-F206844CAS: 103741-08-8 | 97.0% | To inquire | Tue 08 Apr 25 |
![]() | 4-(1,3-Dioxolan-2-yl)benzophenone REF: 3D-DEA74108CAS: 103741-08-8 | Min. 95% | - - - | Discontinued product |

Ref: 10-F206844
1g | To inquire |

4-(1,3-Dioxolan-2-yl)benzophenone
Ref: 3D-DEA74108
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |