CAS 103879-58-9: 5-Methyl-1,3-Oxazole-4-Carboxylic Acid
Description:5-Methyl-1,3-Oxazole-4-Carboxylic Acid is an organic compound characterized by its oxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen atoms. This particular compound features a methyl group at the 5-position and a carboxylic acid functional group at the 4-position of the oxazole ring. It is typically a white to off-white solid and is soluble in polar solvents, reflecting its carboxylic acid functionality. The presence of the carboxylic acid group suggests that it can participate in acid-base reactions, making it a potential candidate for various chemical syntheses and applications in pharmaceuticals or agrochemicals. Additionally, the oxazole ring contributes to its biological activity, as heterocycles are often found in biologically active compounds. Its CAS number, 103879-58-9, allows for precise identification in chemical databases and literature. Overall, 5-Methyl-1,3-Oxazole-4-Carboxylic Acid is a compound of interest in both synthetic and medicinal chemistry due to its unique structural features and potential reactivity.
Formula:C5H5NO3
InChI:InChI=1/C5H5NO3/c1-3-4(5(7)8)6-2-9-3/h2H,1H3,(H,7,8)
- Synonyms:
- 5-Methyl-oxazole-4-carboxylic acid
- 4-Oxazolecarboxylic acid, 5-methyl-
- 5-Methyloxazole-4-Carboxylic Acid
- 5-Methyl-oxazol-4-carboxylic acid
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 5-Methyloxazole-4-carboxylic acid REF: IN-DA003MWECAS: 103879-58-9 | 96% | To inquire | Tue 11 Mar 25 |
 | 5-Methyl-1,3-oxazole-4-carboxylic acid REF: 54-OR6279CAS: 103879-58-9 | 98% | 32.00 € | Wed 12 Mar 25 |
 | 5-Methyl-1,3-oxazole-4-carboxylic acid REF: 10-F037255CAS: 103879-58-9 | 95.0% | To inquire | Fri 21 Mar 25 |
 | 5-Methyloxazole-4-carboxylic acid REF: 3D-FM57216CAS: 103879-58-9 | Min. 95% | - - - | Discontinued product |
5-Methyloxazole-4-carboxylic acid
Ref: IN-DA003MWE
| 1g | 43.00 € | ||
| 5g | 99.00 € | ||
| 25g | 280.00 € | ||
| 100g | To inquire | ||
| 250mg | 26.00 € |
5-Methyl-1,3-oxazole-4-carboxylic acid
Ref: 54-OR6279
| 1g | 32.00 € |
5-Methyl-1,3-oxazole-4-carboxylic acid
Ref: 10-F037255
| 1g | To inquire | ||
| 5g | 80.00 € | ||
| 10g | 146.00 € | ||
| 25g | 324.00 € |
5-Methyloxazole-4-carboxylic acid
Ref: 3D-FM57216
| 1g | Discontinued | Request information | |
| 2g | Discontinued | Request information | |
| 100mg | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
