CAS 103890-81-9: 3-Ethyl 5-methyl 4-[2-[(1E)-3-(1,1-dimethylethoxy)-3-oxo-1-propen-1-yl]phenyl]-1,4-dihydro-2,6-dimethyl-3,5-pyridinedicarboxylate
Description:3-Ethyl 5-methyl 4-[2-[(1E)-3-(1,1-dimethylethoxy)-3-oxo-1-propen-1-yl]phenyl]-1,4-dihydro-2,6-dimethyl-3,5-pyridinedicarboxylate, with CAS number 103890-81-9, is a complex organic compound characterized by its multi-functional structure, which includes a pyridine ring and various substituents that contribute to its chemical properties. This compound features a dihydropyridine framework, which is known for its role in various biological activities and potential applications in pharmaceuticals. The presence of ethyl and methyl groups enhances its lipophilicity, potentially influencing its solubility and bioavailability. The compound also contains a propenyl group, which may participate in further chemical reactions, making it versatile in synthetic chemistry. Its structure suggests potential applications in medicinal chemistry, particularly in the development of compounds with specific biological activities. However, detailed studies on its pharmacological properties, toxicity, and environmental impact would be necessary to fully understand its characteristics and potential uses.
Formula:C25H31NO6
InChI:InChI=1/C25H31NO6/c1-8-31-24(29)21-16(3)26-15(2)20(23(28)30-7)22(21)18-12-10-9-11-17(18)13-14-19(27)32-25(4,5)6/h9-14,22,26H,8H2,1-7H3/b14-13+
InChI key:InChIKey=MQLPBBLKDRVRCO-BUHFOSPRNA-N
SMILES:O=C(OC(C)(C)C)C=CC=1C=CC=CC1C2C(C(=O)OC)=C(NC(=C2C(=O)OCC)C)C
- Synonyms:
- 3,5-Pyridinedicarboxylic acid, 4-[2-[(1E)-3-(1,1-dimethylethoxy)-3-oxo-1-propen-1-yl]phenyl]-1,4-dihydro-2,6-dimethyl-, 3-ethyl 5-methyl ester
- 3,5-Pyridinedicarboxylic acid, 4-[2-[3-(1,1-dimethylethoxy)-3-oxo-1-propenyl]phenyl]-1,4-dihydro-2,6-dimethyl-, ethyl methyl ester, (E)-
- 3-Ethyl 5-methyl 4-[2-[(1E)-3-(1,1-dimethylethoxy)-3-oxo-1-propen-1-yl]phenyl]-1,4-dihydro-2,6-dimethyl-3,5-pyridinedicarboxylate

Ref: IN-DA008WAK
Undefined size | To inquire |

Ethyl Methyl (E)-4-{2-[2-(tert-Butoxycarbonyl)vinyl]phenyl}-1,4-dihydro-2,6-dimethylpyridine-3,5-dicarboxylate
Controlled ProductRef: 86-MM0407.01
25mg | 1,075.00 € | ||
100mg | 1,426.00 € |

Ref: 4Z-L-026
5mg | To inquire | ||
10mg | To inquire | ||
25mg | To inquire | ||
50mg | To inquire | ||
100mg | To inquire |

Lacidipine Monomethyl Ester
Controlled ProductRef: TR-L098005
250mg | 1,568.00 € |