CAS 103974-29-4: N-Acetyl-S-(N-methylcarbamoyl)cysteine
Description:N-Acetyl-S-(N-methylcarbamoyl)cysteine, with the CAS number 103974-29-4, is a chemical compound that belongs to the class of cysteine derivatives. It features a cysteine backbone modified with an N-acetyl group and an N-methylcarbamoyl substituent, which contributes to its unique properties. This compound is characterized by its thiol group, which can participate in redox reactions, making it relevant in biochemical processes. It is often studied for its potential therapeutic applications, particularly in the context of antioxidant activity and as a mucolytic agent. The presence of the acetyl and carbamoyl groups enhances its solubility and stability in biological systems. Additionally, N-Acetyl-S-(N-methylcarbamoyl)cysteine may exhibit interactions with various biological targets, influencing cellular pathways. Its synthesis typically involves the modification of cysteine through acetylation and carbamoylation reactions. Overall, this compound represents a significant interest in medicinal chemistry and pharmacology due to its functional groups and potential biological activities.
Formula:C7H12N2O4S
InChI:InChI=1S/C7H12N2O4S/c1-4(10)9-5(6(11)12)3-14-7(13)8-2/h5H,3H2,1-2H3,(H,8,13)(H,9,10)(H,11,12)/t5-/m0/s1
InChI key:InChIKey=MXRPNYMMDLFYDL-YFKPBYRVSA-N
SMILES:O=C(SCC(NC(=O)C)C(=O)O)NC
- Synonyms:
- (2R)-2-Acetamido-3-[(methylcarbamoyl)sulfanyl]propanoic acid
- (R)-2-Acetamido-3-((methylcarbamoyl)thio)propanoic acid
- <span class="text-smallcaps">L</span>-Cysteine, N-acetyl-, methylcarbamate (ester)
- <span class="text-smallcaps">L</span>-Cysteine, N-acetyl-S-[(methylamino)carbonyl]-
- N-Acetyl-S-(N-methylcarbamoyl)cysteine
- N-Acetyl-S-[(methylamino)carbonyl]-<span class="text-smallcaps">L</span>-cysteine
- N-acetyl-S-(methylcarbamoyl)-L-cysteine
- N-acetyl-S-(methylcarbamoyl)cysteine
- S-(N-Methylcarbamoyl)-N-acetylcysteine
- L-Cysteine, N-acetyl-, methylcarbamate (ester)
- See more synonyms
- L-Cysteine, N-acetyl-S-[(methylamino)carbonyl]-
- N-Acetyl-S-[(methylamino)carbonyl]-L-cysteine

N-ACETYL-S-(N-METHYLCARBAMOYL)-L-CYSTEINE
Ref: IN-DA003SP8
Undefined size | To inquire |

Ref: 4Z-C-77101
5mg | 375.00 € | ||
10mg | 545.00 € | ||
25mg | 885.00 € | ||
50mg | 1,237.00 € | ||
100mg | 2,148.00 € |

N-Acetyl-S-(N-methylcarbamoyl)-L-cysteine
Controlled ProductRef: TR-A186625
5mg | 299.00 € | ||
10mg | 422.00 € | ||
100mg | 2,877.00 € |

N-Acetyl-S-(N-methylcarbamoyl)-L-cysteine 1,2,3-13C3,15N Sodium Salt
Ref: TR-A186623
1mg | 1,629.00 € | ||
5mg | 7,586.00 € | ||
500µg | 952.00 € |

N-Acetyl-S-(N-methylcarbamoyl)-L-cysteine
Ref: 3D-FA17174
5mg | Discontinued | Request information | |
10mg | Discontinued | Request information | |
25mg | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information |