CAS 1040084-43-2: 6-Chloro-N-(2,5-difluorophenyl)-3-pyridinesulfonamide
Description:6-Chloro-N-(2,5-difluorophenyl)-3-pyridinesulfonamide is a chemical compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. The presence of a chloro group and a difluorophenyl moiety contributes to its unique reactivity and potential biological activity. This compound features a pyridine ring, which is a six-membered aromatic heterocycle containing nitrogen, enhancing its solubility and interaction with biological targets. The difluorophenyl group may influence the compound's lipophilicity and binding affinity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular structure suggests potential applications in drug design, especially in targeting specific enzymes or receptors. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the halogen substituents. Overall, 6-Chloro-N-(2,5-difluorophenyl)-3-pyridinesulfonamide represents a class of compounds that may exhibit significant pharmacological properties, warranting further investigation in the context of drug discovery and development.
Formula:C11H7ClF2N2O2S
InChI:InChI=1S/C11H7ClF2N2O2S/c12-11-4-2-8(6-15-11)19(17,18)16-10-5-7(13)1-3-9(10)14/h1-6,16H
InChI key:InChIKey=ZVJYWPWLLJDVRX-UHFFFAOYSA-N
SMILES:O=S(=O)(NC1=CC(F)=CC=C1F)C2=CN=C(Cl)C=C2
- Synonyms:
- 6-Chloro-N-(2,5-difluorophenyl)-3-pyridinesulfonamide
- 3-Pyridinesulfonamide, 6-chloro-N-(2,5-difluorophenyl)-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 6-Chloro-N-(2,5-difluorophenyl)pyridine-3-sulfonamide REF: 3D-QRB08443CAS: 1040084-43-2 | Min. 95% | To inquire | Thu 08 May 25 |
![]() | 6-Chloro-N-(2,5-difluorophenyl)pyridine-3-sulfonamide REF: 10-F671209CAS: 1040084-43-2 | 95% | - - - | Discontinued product |

6-Chloro-N-(2,5-difluorophenyl)pyridine-3-sulfonamide
Ref: 3D-QRB08443
50mg | 457.00 € | ||
500mg | 1,173.00 € |

6-Chloro-N-(2,5-difluorophenyl)pyridine-3-sulfonamide
Ref: 10-F671209
1g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |