CAS 10413-34-0: 2-Amino-4-(1,1-dimethylethyl)-3-thiophenecarbonitrile
Description:2-Amino-4-(1,1-dimethylethyl)-3-thiophenecarbonitrile, with the CAS number 10413-34-0, is an organic compound characterized by the presence of a thiophene ring, an amino group, and a carbonitrile functional group. This compound features a tert-butyl group (1,1-dimethylethyl) attached to the thiophene, which contributes to its hydrophobic properties and steric bulk. The amino group can participate in hydrogen bonding, influencing its solubility and reactivity. The carbonitrile group is known for its electron-withdrawing properties, which can affect the compound's reactivity in various chemical reactions. Typically, compounds like this may exhibit biological activity, making them of interest in pharmaceutical research. The presence of both electron-donating and electron-withdrawing groups can lead to interesting electronic properties, potentially affecting the compound's behavior in different environments. Overall, this compound's unique structure suggests potential applications in organic synthesis and medicinal chemistry, although specific applications would depend on further research and characterization.
Formula:C9H12N2S
InChI:InChI=1S/C9H12N2S/c1-9(2,3)7-5-12-8(11)6(7)4-10/h5H,11H2,1-3H3
InChI key:InChIKey=HLCATPHPMNURNM-UHFFFAOYSA-N
SMILES:N#CC1=C(SC=C1C(C)(C)C)N
- Synonyms:
- 2-Amino-4-tert-butylthiophene-3-carbonitrile
- 3-Thiophenecarbonitrile, 2-amino-4-tert-butyl-
- 3-Thiophenecarbonitrile, 2-amino-4-(1,1-dimethylethyl)-
- 2-Amino-3-cyano-4-tert-butyl-thiophene
- 2-Amino-4-(1,1-dimethylethyl)-3-thiophenecarbonitrile
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2-Amino-4-tert-butylthiophene-3-carbonitrile REF: 3D-KAA41334CAS: 10413-34-0 | Min. 95% | To inquire | Thu 08 May 25 |
![]() | 2-Amino-4-(tert-butyl)thiophene-3-carbonitrile REF: 10-F656780CAS: 10413-34-0 | 95% | - - - | Discontinued product |

2-Amino-4-tert-butylthiophene-3-carbonitrile
Ref: 3D-KAA41334
5g | 1,012.00 € | ||
500mg | 373.00 € |

2-Amino-4-(tert-butyl)thiophene-3-carbonitrile
Ref: 10-F656780
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
2.5g | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |