CAS 10414-81-0: 2'-Amino-2'-deoxyadenosine
Description:2'-Amino-2'-deoxyadenosine is a nucleoside analog of adenosine, characterized by the presence of an amino group at the 2' position of the ribose sugar. This modification alters its biochemical properties and interactions. The molecular formula of 2'-amino-2'-deoxyadenosine reflects its composition, which includes carbon, hydrogen, nitrogen, and oxygen atoms. It is typically a white to off-white solid and is soluble in water, making it suitable for various biochemical applications. This compound plays a role in nucleic acid metabolism and can be involved in studies related to DNA and RNA synthesis, as well as in the development of antiviral and anticancer agents. Its structural similarity to natural nucleosides allows it to participate in enzymatic reactions, potentially influencing cellular processes. Additionally, the presence of the amino group can enhance its binding affinity to specific enzymes or receptors, making it a valuable tool in molecular biology and medicinal chemistry research.
Formula:C10H14N6O3
InChI:InChI=1/C10H14N6O3/c11-5-7(18)4(1-17)19-10(5)16-3-15-6-8(12)13-2-14-9(6)16/h2-5,7,10,17-18H,1,11H2,(H2,12,13,14)/t4-,5?,7-,10-/m1/s1
- Synonyms:
- 2'-Amino-D-Adenosine
- 2'-Amino-2'-deoxy-D-adenosine
- (2R,3S,4R,5R)-4-Amino-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol
- 9-(2-amino-2-deoxypentofuranosyl)-9H-purin-6-amine
