CAS 104160-97-6

(2S,3aS,6aS)-1-[(2S)-2-aminopropanoyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxylic acid

Description:

The chemical substance known as (2S,3aS,6aS)-1-[(2S)-2-aminopropanoyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxylic acid, with the CAS number 104160-97-6, is a cyclic compound characterized by its complex polycyclic structure and specific stereochemistry. It features a hexahydro-cyclopentapyrrole framework, which contributes to its potential biological activity. The presence of an amino acid moiety, specifically an aminopropanoyl group, suggests that this compound may exhibit properties relevant to peptide synthesis or biological interactions, possibly acting as a building block for larger biomolecules. The carboxylic acid functional group indicates that it can participate in acid-base reactions and may influence solubility and reactivity. Its stereochemical configuration is crucial for its biological activity, as the spatial arrangement of atoms can significantly affect how the molecule interacts with biological targets. Overall, this compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals or as a research tool in biochemical studies.

Formula: C₁₁H₁₈N₂O₃

InChI: InChI=1/C11H18N2O3/c1-6(12)10(14)13-8-4-2-3-7(8)5-9(13)11(15)16/h6-9H,2-5,12H2,1H3,(H,15,16)/t6-,7-,8-,9-/m0/s1

SMILES: C[C@@H](C(=O)N1[C@H]2CCC[C@H]2C[C@H]1C(=O)O)N