CAS 104216-46-8: 3-[(3,4-DIMETHYLPHENYL)THIO]PROPANOIC ACID

Description: 3-[(3,4-Dimethylphenyl)thio]propanoic acid is an organic compound characterized by its unique structure, which includes a propanoic acid backbone and a thioether functional group attached to a dimethyl-substituted phenyl ring. This compound typically exhibits properties associated with both aromatic and aliphatic systems, such as moderate solubility in organic solvents and potential reactivity due to the presence of the carboxylic acid functional group. The dimethyl groups on the phenyl ring can influence its steric and electronic properties, potentially affecting its reactivity and interactions with other molecules. Additionally, the thioether linkage may impart specific characteristics, such as increased lipophilicity and altered metabolic pathways. This compound may be of interest in various fields, including medicinal chemistry and materials science, due to its potential applications in drug development or as a building block in organic synthesis. As with many organic compounds, safety and handling precautions should be observed, particularly regarding its reactivity and potential toxicity.

Formula: C₁₁H₁₄O₂S

InChI: InChI=1/C11H14O2S/c1-8-3-4-10(7-9(8)2)14-6-5-11(12)13/h3-4,7H,5-6H2,1-2H3,(H,12,13)

Synonyms:

• 3-[(3,4-Dimethylphenyl)Sulfanyl]Propanoate
• 3-[(3,4-Dimethylphenyl)Sulfanyl]Propanoic Acid

3-[(3,4-Dimethylphenyl)thio]propanoic acid

CAS: 104216-46-8

Versatile small molecule scaffold

• Formula: C₁₁H₁₄O₂S
• Purity: Min. 95%
• Molecular weight: 210.29 g/mol

3-[(3,4-dimethylphenyl)sulfanyl]propanoic acid

CAS: 104216-46-8

• Purity: 97%
• Molecular weight: 210.2899932861328