CAS 104224-68-2: 2-(1-Adamantyl)-4-bromophenol

Description:2-(1-Adamantyl)-4-bromophenol, with the CAS number 104224-68-2, is an organic compound characterized by its unique structure that combines an adamantyl group with a bromophenol moiety. This compound typically exhibits a solid state at room temperature and is known for its potential applications in medicinal chemistry and material science due to its interesting biological and chemical properties. The presence of the bromine atom enhances its reactivity and can influence its solubility in various solvents. The adamantyl group contributes to the compound's hydrophobic characteristics, which may affect its interaction with biological membranes. Additionally, the phenolic hydroxyl group can participate in hydrogen bonding, influencing its behavior in different chemical environments. Overall, 2-(1-Adamantyl)-4-bromophenol is a compound of interest for further research, particularly in the fields of drug development and synthetic chemistry, where its unique structural features may lead to novel applications.

Formula:C₁₆H₁₉BrO

InChI:InChI=1/C16H19BrO/c17-13-1-2-15(18)14(6-13)16-7-10-3-11(8-16)5-12(4-10)9-16/h1-2,6,10-12,18H,3-5,7-9H2/t10-,11-,12-,16-

Synonyms:
4-Bromo-2-Adamantyl Phenol
(2-Adamantyl)-4-Bromophenol
2-(Adamantan-1-yl)-4-bromophenol
2-Adamantane-4-Bromoanisole
2-(Adamantan-1-yl)-4-bromophenol 98%
2-(1-Adamantyl)-4-bromophenol (Adapalene)
4-Bromo-2-Tricyclo[3.3.1.1~3,7~]Dec-1-Ylphenol

Found 4 products.

Product data	Purity	Price range	Estimated delivery
2-(1-Adamantyl)-4-bromophenol REF: IN-DA007I84CAS: 104224-68-2	98%	116.00 €~545.00 €	Thu 27 Mar 25
2-(Adamantan-1-yl)-4-bromophenol REF: 54-OR3491CAS: 104224-68-2	98%	To inquire	Thu 03 Apr 25
2-(1-Adamantyl)-4-bromophenol REF: 3D-FA70832CAS: 104224-68-2	Min. 95%	77.00 €~1,979.00 €	Mon 07 Apr 25
2-(1-Adamantyl)-4-bromophenol REF: 10-F213213CAS: 104224-68-2	98%	- - -	Discontinued product