
CAS 10444-90-3: N-[5-(Trifluoromethyl)-1,3,4-thiadiazol-2-yl]benzenesulfonamide
Description:N-[5-(Trifluoromethyl)-1,3,4-thiadiazol-2-yl]benzenesulfonamide is a chemical compound characterized by its unique structural features, which include a thiadiazole ring and a sulfonamide group. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its biological activity. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many sulfonamide derivatives. It may also display interesting pharmacological properties, making it a subject of interest in medicinal chemistry. The thiadiazole moiety is known for its potential applications in agrochemicals and pharmaceuticals, often contributing to antimicrobial and anti-inflammatory activities. Additionally, the sulfonamide group is recognized for its role in various therapeutic agents, particularly in the treatment of bacterial infections. Overall, N-[5-(Trifluoromethyl)-1,3,4-thiadiazol-2-yl]benzenesulfonamide represents a compound with significant potential in both research and application, particularly in the fields of chemistry and pharmacology.
Formula:C9H6F3N3O2S2
InChI:InChI=1S/C9H6F3N3O2S2/c10-9(11,12)7-13-14-8(18-7)15-19(16,17)6-4-2-1-3-5-6/h1-5H,(H,14,15)
InChI key:InChIKey=YHTDPSNGBGWFKO-UHFFFAOYSA-N
SMILES:O=S(=O)(NC1=NN=C(S1)C(F)(F)F)C=2C=CC=CC2
- Synonyms:
- N-[5-(Trifluoromethyl)-1,3,4-thiadiazol-2-yl]benzenesulfonamide
- Benzenesulfonamide, N-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | N-(5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl)benzenesulfonamide REF: 10-F725705CAS: 10444-90-3 | 90% | - - - | Discontinued product |

N-(5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl)benzenesulfonamide
Ref: 10-F725705
1g | Discontinued | Request information |