CAS 104542-46-3: urdamycin B
Description:Urdamycin B is a natural antibiotic compound belonging to the class of anthracycline antibiotics, which are known for their potent antibacterial properties. It is produced by the fermentation of certain strains of Streptomyces bacteria. Urdamycin B exhibits a complex molecular structure characterized by a polycyclic ring system, which contributes to its biological activity. The compound has shown effectiveness against a range of Gram-positive bacteria, making it of interest in the field of medicinal chemistry and antibiotic development. Its mechanism of action typically involves interference with bacterial DNA synthesis, leading to cell death. Additionally, urdamycin B may possess antitumor properties, although its primary application remains in combating bacterial infections. As with many antibiotics, the potential for resistance development is a concern, necessitating ongoing research into its efficacy and safety profile. Overall, urdamycin B represents a significant compound in the study of natural products and their applications in pharmacology.
Formula:C37H44O13
InChI:InChI=1S/C37H44O13/c1-15-24(49-28-11-22(38)32(40)16(2)48-28)9-10-27(47-15)50-26-12-25(46-17(3)33(26)41)19-7-8-21-31(34(19)42)36(44)20-6-5-18-13-37(4,45)14-23(39)29(18)30(20)35(21)43/h5-8,15-17,22,24-28,32-33,38,40-42,45H,9-14H2,1-4H3/t15-,16+,17+,22+,24-,25+,26+,27-,28-,32+,33+,37+/m0/s1
InChI key:InChIKey=RVYIFZVNJLDNAV-VSYBRGMMSA-N
SMILES:O=C1C2=CC=C3C(C(=O)CC(O)(C)C3)=C2C(=O)C4=CC=C(C(O)=C14)C5OC(C)C(O)C(OC6OC(C)C(OC7OC(C)C(O)C(O)C7)CC6)C5
- Synonyms:
- (1R)-1,5-anhydro-2,6-dideoxy-3-O-{(2S,5S,6S)-5-[(2,6-dideoxy-beta-D-arabino-hexopyranosyl)oxy]-6-methyltetrahydro-2H-pyran-2-yl}-1-[(3R)-3,8-dihydroxy-3-methyl-1,7,12-trioxo-1,2,3,4,7,12-hexahydrotetraphen-9-yl]-D-arabino-hexitol
- (3R)-9-[2,6-Dideoxy-3-O-[(2S,5S,6S)-5-[(2,6-dideoxy-β-<span class="text-smallcaps">D</smallcap>-arabino-hexopyranosyl)oxy]tetrahydro-6-methyl-2H-pyran-2-yl]-β-<smallcap>D</span>-arabino-hexopyranosyl]-3,4-dihydro-3,8-dihydroxy-3-methylbenz[a]anthracene-1,7,12(2H)-trione
- (R)-9-(2,6-Dideoxy-3-O-((2S-(2alpha,5beta,6beta))-5-((2,6-dideoxy-beta-D-arabino-hexopyranosyl)oxy)tetrahydro-6-methyl-2H-pyran-2-yl)-beta-D-arabino-hexopyranosyl)-3,4-dihydro-3,8-dihydroxy-3-methylbenz(a)anthracene-1,7,12(2H)-trione
- Benz(a)anthracene-1,7,12(2H)-trione, 9-(2,6-dideoxy-3-O-((2S-(2alpha,5beta,6beta))-5-((2,6-dideoxy-beta-D-arabino-hexopyranosyl)oxy)tetrahydro-6-methyl-2H-pyran-2-yl)-beta-D-arabino-hexopyranosyl)-3,4-dihydro-3,8-dihydroxy-3-methyl-, (R)-
- Benz[a]anthracene-1,7,12(2H)-trione, 9-[2,6-dideoxy-3-O-[(2S,5S,6S)-5-[(2,6-dideoxy-β-<span class="text-smallcaps">D</smallcap>-arabino-hexopyranosyl)oxy]tetrahydro-6-methyl-2H-pyran-2-yl]-β-<smallcap>D</span>-arabino-hexopyranosyl]-3,4-dihydro-3,8-dihydroxy-3-methyl-, (3R)-
- Benz[a]anthracene-1,7,12(2H)-trione, 9-[2,6-dideoxy-3-O-[[2S-(2α,5β,6β)]-5-[(2,6-dideoxy-β-<span class="text-smallcaps">D</smallcap>-arabino-hexopyranosyl)oxy]tetrahydro-6-methyl-2H-pyran-2-yl]-β-<smallcap>D</span>-arabino-hexopyranosyl]-3,4-dihydro-3,8-dihydroxy-3-methyl-, (R)-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Urdamycin B REF: 8R-JU0097CAS: 104542-46-3 | 88.18% | To inquire | Thu 27 Feb 25 |
![]() | Urdamycin B REF: TM-TN7537CAS: 104542-46-3 | - - - | To inquire | Tue 04 Mar 25 |
![]() | Urdamycin B REF: 3D-EEA54246CAS: 104542-46-3 | Min. 95% | 608.00 €~5,309.00 € | Mon 14 Apr 25 |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
Urdamycin B
Ref: 8R-JU0097
1mg | To inquire | ||
5mg | To inquire |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
Urdamycin B
Ref: TM-TN7537
10mg | To inquire | ||
50mg | To inquire |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
Urdamycin B
Ref: 3D-EEA54246
1mg | 608.00 € | ||
5mg | 1,770.00 € | ||
10mg | 2,832.00 € | ||
25mg | 5,309.00 € |