CAS 104579-03-5: 5'-O-(4,4'-DIMETHOXYTRITYL)-N4-BENZOYL-5-METHYL-2'-DEOXYCYTIDINE
Description:5'-O-(4,4'-Dimethoxytrityl)-N4-benzoyl-5-methyl-2'-deoxycytidine is a modified nucleoside derivative, primarily utilized in the field of nucleic acid chemistry and molecular biology. This compound features a deoxycytidine backbone, which is a component of DNA, and is characterized by the presence of a 5'-O-dimethoxytrityl protecting group that enhances its stability and solubility during synthesis. The N4-benzoyl modification provides additional steric hindrance and can influence the nucleoside's reactivity, making it useful in oligonucleotide synthesis. The methyl group at the 5-position of the cytosine base contributes to its unique properties, potentially affecting base pairing and hybridization characteristics. This compound is typically used in the synthesis of oligonucleotides, where protecting groups are essential for selective reactions. Its structural modifications allow for improved efficiency in the synthesis process and can enhance the overall performance of the resulting nucleic acids in various applications, including gene therapy and molecular diagnostics.
Formula:C38H37N3O7
InChI:InChI=1S/C38H37N3O7/c1-25-23-41(37(44)40-35(25)39-36(43)26-10-6-4-7-11-26)34-22-32(42)33(48-34)24-47-38(27-12-8-5-9-13-27,28-14-18-30(45-2)19-15-28)29-16-20-31(46-3)21-17-29/h4-21,23,32-34,42H,22,24H2,1-3H3,(H,39,40,43,44)/t32-,33+,34+/m0/s1
InChI key:InChIKey=YWHPQMVQHSPNRU-LBFZIJHGSA-N
SMILES:O=C1N=C(NC(=O)C=2C=CC=CC2)C(=CN1C3OC(COC(C=4C=CC=CC4)(C5=CC=C(OC)C=C5)C6=CC=C(OC)C=C6)C(O)C3)C
- Synonyms:
- 3: PN: US20030211606 PAGE: 16 claimed DNA
- 3: PN: US20030212017 PAGE: 17 claimed DNA
- 4: PN: US20030198965 PAGE: 17 claimed DNA
- 4: PN: US20040014048 PAGE: 17 claimed DNA
- 4: PN: US20040014049 PAGE: 18 claimed DNA
- 5: PN: US20040005565 PAGE: 17-22 claimed DNA
- 5: PN: US20040005569 PAGE: 19 claimed DNA
- 5: PN: US20040005570 PAGE: 17 claimed DNA
- 5: PN: US20040006029 PAGE: 20 claimed DNA
- 5: PN: US20040006030 PAGE: 20 claimed DNA
- See more synonyms
- 5: PN: US20040014047 PAGE: 17 claimed DNA
- 5: PN: US20040014050 PAGE: 17 claimed DNA
- 5: PN: US20040014051 PAGE: 19 claimed DNA
- 5: PN: US20040014699 PAGE: 17 claimed DNA
- 5: PN: WO03106645 PAGE: 62 claimed DNA
- 77: PN: US20040005707 PAGE: 17 claimed DNA
- Cytidine, N-benzoyl-5′-O-[bis(4-methoxyphenyl)phenylmethyl]-2′-deoxy-5-methyl-
- Dmt-Nbz-5-Methyl Dc
- N-Benzoyl-5′-O-[bis(4-methoxyphenyl)phenylmethyl]-2′-deoxy-5-methylcytidine

5'-O-(4,4'-DIMETHOXYTRITYL)-N4-BENZOYL-5-METHYL-2'-DEOXYCYTIDINE
Ref: IN-DA008T7Z
1g | 163.00 € | ||
250mg | 81.00 € |

5'-O-DMT-N4-Bz-5-Me-dC
Ref: TM-T37138
100mg | 49.00 € | ||
1mL*10mM (DMSO) | 55.00 € |

N4-Benzoyl-2'-deoxy-5'-O-DMT-5-methylcytidine
Ref: 3D-ND57348
5g | 323.00 € | ||
10g | 482.00 € | ||
25g | 919.00 € | ||
50g | 1,513.00 € | ||
100g | 2,592.00 € |