CAS 1046-56-6: 3-(2-Pyridyl)-5,6-diphenyl-1,2,4-triazine
Description:3-(2-Pyridyl)-5,6-diphenyl-1,2,4-triazine, with the CAS number 1046-56-6, is a heterocyclic organic compound characterized by its triazine ring structure, which incorporates both pyridine and phenyl groups. This compound typically exhibits a yellow to orange color and is known for its potential applications in various fields, including pharmaceuticals, agrochemicals, and materials science. The presence of the pyridine moiety contributes to its ability to participate in coordination chemistry, while the diphenyl substituents enhance its stability and solubility in organic solvents. Additionally, 3-(2-Pyridyl)-5,6-diphenyl-1,2,4-triazine may exhibit interesting electronic properties, making it a candidate for use in organic light-emitting diodes (OLEDs) and other optoelectronic devices. Its reactivity and interaction with other chemical species can be influenced by the functional groups present, allowing for diverse synthetic pathways and applications in research and industry.
Formula:C20H14N4
InChI:InChI=1S/C20H14N4/c1-3-9-15(10-4-1)18-19(16-11-5-2-6-12-16)23-24-20(22-18)17-13-7-8-14-21-17/h1-14H
InChI key:InChIKey=OTMYLOBWDNFTLO-UHFFFAOYSA-N
SMILES:N1=NC(C2=CC=CC=C2)=C(N=C1C=3N=CC=CC3)C=4C=CC=CC4
- Synonyms:
- 1,2,4-Triazine, 5,6-diphenyl-3-(2-pyridinyl)-
- 3-(Pyridin-2-yl)-5,6-diphenyl-1,2,4-triazine
- 5,6-Diphenyl-3-(2-pyridinyl)-1,2,4-triazine
- 5,6-Diphenyl-3-(2-pyridyl)-1,2,4-triazine
- 5,6-Diphenyl-3-(2-pyridyl)-1,2,4-triazine~PDT
- 5,6-Diphenyl-3-(Pyridin-2-Yl)-1,2,4-Triazine
- 5,6-Diphenyl-3-(pyridin-2-yl)-as-triazine
- Ferroprint
- Ferrotrace
- NSC 242686
- See more synonyms
- PDT
- PDT (ligand)
- as-Triazine, 5,6-diphenyl-3-(2-pyridyl)-
- 3-(2-Pyridyl)-5,6-diphenyl-1,2,4-triazine