CAS 104777-68-6: plantamajoside
Description:Plantamajoside is a naturally occurring phenylethanoid glycoside, primarily derived from various plant species, including those in the genus Plantago. It is characterized by its structural composition, which includes a phenylethanoid backbone linked to a sugar moiety, typically rhamnose or glucose. This compound exhibits a range of biological activities, including anti-inflammatory, antioxidant, and antimicrobial properties, making it of interest in pharmacological research. Plantamajoside is often studied for its potential therapeutic applications, particularly in traditional medicine. Its solubility in water and organic solvents varies, which can influence its bioavailability and efficacy in different formulations. Additionally, plantamajoside's safety profile has been evaluated, indicating low toxicity levels, which supports its use in herbal remedies and dietary supplements. Overall, this compound represents a significant area of interest in natural product chemistry and pharmacognosy, highlighting the importance of plant-derived substances in modern medicine.
Formula:C29H36O16
InChI:InChI=1S/C29H36O16/c30-11-19-22(37)23(38)24(39)29(42-19)45-27-25(40)28(41-8-7-14-2-5-16(33)18(35)10-14)43-20(12-31)26(27)44-21(36)6-3-13-1-4-15(32)17(34)9-13/h1-6,9-10,19-20,22-35,37-40H,7-8,11-12H2/b6-3+/t19-,20-,22-,23+,24-,25-,26-,27-,28-,29+/m1/s1
InChI key:InChIKey=KFEFLPDKISUVNR-QJEHNBJNSA-N
SMILES:O=C(OC1C(OC(OCCC2=CC=C(O)C(O)=C2)C(O)C1OC3OC(CO)C(O)C(O)C3O)CO)C=CC4=CC=C(O)C(O)=C4
- Synonyms:
- 2-(3,4-dihydroxyphenyl)ethyl 4-O-[(2E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]-3-O-beta-D-glucopyranosyl-beta-D-glucopyranoside
- Plantamoside
- Purpureaside A
- β-<span class="text-smallcaps">D</smallcap>-Glucopyranoside, 2-(3,4-dihydroxyphenyl)ethyl 3-O-β-<smallcap>D</span>-glucopyranosyl-, 4-[(2E)-3-(3,4-dihydroxyphenyl)-2-propenoate]
- β-<span class="text-smallcaps">D</smallcap>-Glucopyranoside, 2-(3,4-dihydroxyphenyl)ethyl 3-O-β-<smallcap>D</span>-glucopyranosyl-, 4-[3-(3,4-dihydroxyphenyl)-2-propenoate], (E)-
