CAS 104872-06-2: (3S,4S)-3-Hexyl-4-[(2R)-2-hydroxytridecyl]-2-oxetanone
Description:(3S,4S)-3-Hexyl-4-[(2R)-2-hydroxytridecyl]-2-oxetanone is a chemical compound characterized by its unique oxetanone structure, which features a four-membered cyclic ester. The presence of a hexyl group and a hydroxytridecyl substituent indicates that this compound has significant hydrophobic characteristics, making it potentially useful in applications involving surfactants or emulsifiers. The stereochemistry, denoted by the (3S,4S) and (2R) configurations, suggests that the compound has specific spatial arrangements that could influence its biological activity and interactions with other molecules. This compound may exhibit properties such as solubility in organic solvents and varying degrees of stability depending on environmental conditions. Its potential applications could span across fields such as pharmaceuticals, materials science, and biochemistry, particularly in the development of novel compounds with tailored properties for specific uses. However, detailed studies would be necessary to fully understand its reactivity, stability, and potential applications in various domains.
Formula:C22H42O3
InChI:InChI=1S/C22H42O3/c1-3-5-7-9-10-11-12-13-14-16-19(23)18-21-20(22(24)25-21)17-15-8-6-4-2/h19-21,23H,3-18H2,1-2H3/t19-,20+,21+/m1/s1
InChI key:InChIKey=RSOUWOFYULUWNE-HKBOAZHASA-N
SMILES:O=C1OC(CC(O)CCCCCCCCCCC)C1CCCCCC
- Synonyms:
- (3S,4S)-3-Hexyl-4-[(2R)-2-hydroxytridecyl]-2-oxetanone
- (3S,4S)-3-Hexyl-4-[(2R)-2-hydroxytridecyl]oxetan-2-one
- (3S,4S)-3-Hexyl-4-[(R)-2-(Hydroxytridecyl)]Oxetan-2-One
- 2-Oxetanone, 3-hexyl-4-(2-hydroxytridecyl)-, [3S-[3α,4β(S*)]]-
- 2-oxetanone, 3-hexyl-4-[(2R)-2-hydroxytridecyl]-, (3S,4S)-