CAS 1049706-72-0: 3-Bromo-4-methyl-5-nitro-2(1H)-pyridinone
Description:3-Bromo-4-methyl-5-nitro-2(1H)-pyridinone is a heterocyclic organic compound characterized by its pyridinone structure, which features a bromine atom, a methyl group, and a nitro group attached to the pyridine ring. This compound typically exhibits a pale yellow to brownish color and is soluble in polar organic solvents. The presence of the nitro group contributes to its potential as a reactive intermediate in various chemical reactions, while the bromine atom can serve as a site for further substitution reactions. The compound's molecular structure suggests it may possess biological activity, making it of interest in pharmaceutical research. Its properties, such as melting point, boiling point, and specific reactivity, can vary based on environmental conditions and the presence of other functional groups. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 3-Bromo-4-methyl-5-nitro-2(1H)-pyridinone is a versatile compound with potential applications in organic synthesis and medicinal chemistry.
Formula:C6H5BrN2O3
InChI:InChI=1S/C6H5BrN2O3/c1-3-4(9(11)12)2-8-6(10)5(3)7/h2H,1H3,(H,8,10)
InChI key:InChIKey=JJTIUCLTXGGQCH-UHFFFAOYSA-N
SMILES:O=C1NC=C(C(=C1Br)C)N(=O)=O
- Synonyms:
- 3-Bromo-4-methyl-5-nitro-2(1H)-pyridinone
- 3-Bromo-4-methyl-5-nitro-1H-pyridin-2-one
- 2(1H)-Pyridinone, 3-bromo-4-methyl-5-nitro-
- 2-Hydroxy-3-bromo-4-methyl-5-nitropyridine
- 3-Bromo-4-methyl-5-nitro-1,2-dihydropyridin-2-one

3-Bromo-4-methyl-5-nitropyridin-2-ol
Ref: IN-DA003J29
1g | 118.00 € | ||
5g | 237.00 € | ||
10g | 639.00 € | ||
25g | To inquire | ||
100mg | 53.00 € | ||
250mg | 64.00 € |

3-Bromo-4-methyl-5-nitro-2-pyridinone
Ref: 54-OR930522
1g | 147.00 € | ||
5g | 362.00 € | ||
25g | 1,395.00 € |

3-Bromo-4-methyl-5-nitropyridin-2(1H)-one
Ref: 10-F328300
1g | 97.00 € | ||
5g | 239.00 € | ||
10g | 440.00 € | ||
25g | 909.00 € | ||
2.5g | 206.00 € |

3-Bromo-4-methyl-5-nitro-2-pyridinone
Ref: 3D-ZRB70672
2500mg | 388.00 € |