CAS 1049706-72-0: 3-Bromo-4-methyl-5-nitro-2(1H)-pyridinone

Description:3-Bromo-4-methyl-5-nitro-2(1H)-pyridinone is a heterocyclic organic compound characterized by its pyridinone structure, which features a bromine atom, a methyl group, and a nitro group attached to the pyridine ring. This compound typically exhibits a pale yellow to brownish color and is soluble in polar organic solvents. The presence of the nitro group contributes to its potential as a reactive intermediate in various chemical reactions, while the bromine atom can serve as a site for further substitution reactions. The compound's molecular structure suggests it may possess biological activity, making it of interest in pharmaceutical research. Its properties, such as melting point, boiling point, and specific reactivity, can vary based on environmental conditions and the presence of other functional groups. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 3-Bromo-4-methyl-5-nitro-2(1H)-pyridinone is a versatile compound with potential applications in organic synthesis and medicinal chemistry.

Formula:C₆H₅BrN₂O₃

InChI:InChI=1S/C6H5BrN2O3/c1-3-4(9(11)12)2-8-6(10)5(3)7/h2H,1H3,(H,8,10)

InChI key:InChIKey=JJTIUCLTXGGQCH-UHFFFAOYSA-N

SMILES:O=C1NC=C(C(=C1Br)C)N(=O)=O

Synonyms:
3-Bromo-4-methyl-5-nitro-2(1H)-pyridinone
3-Bromo-4-methyl-5-nitro-1H-pyridin-2-one
2(1H)-Pyridinone, 3-bromo-4-methyl-5-nitro-
2-Hydroxy-3-bromo-4-methyl-5-nitropyridine
3-Bromo-4-methyl-5-nitro-1,2-dihydropyridin-2-one

Found 4 products.

Product data	Purity	Price range	Estimated delivery
3-Bromo-4-methyl-5-nitropyridin-2-ol REF: IN-DA003J29CAS: 1049706-72-0	95%	To inquire	Tue 04 Mar 25
3-Bromo-4-methyl-5-nitro-2-pyridinone REF: 54-OR930522CAS: 1049706-72-0	95%	147.00 €~1,395.00 €	Mon 03 Mar 25
3-Bromo-4-methyl-5-nitropyridin-2(1H)-one REF: 10-F328300CAS: 1049706-72-0	95.0%	97.00 €~909.00 €	Wed 05 Mar 25
3-Bromo-4-methyl-5-nitro-2-pyridinone REF: 3D-ZRB70672CAS: 1049706-72-0	Min. 95%	To inquire	Tue 15 Apr 25