CAS 10500-57-9: 5,6,7,8-TETRAHYDROQUINOLINE
Description:5,6,7,8-Tetrahydroquinoline is a bicyclic organic compound characterized by a fused ring structure that includes a six-membered aromatic ring and a five-membered nitrogen-containing ring. It is a colorless to pale yellow liquid at room temperature, exhibiting a distinctive aromatic odor. This compound is known for its role as an intermediate in the synthesis of various pharmaceuticals and agrochemicals. Its molecular formula is C9H11N, and it has a relatively low boiling point, which makes it volatile. 5,6,7,8-Tetrahydroquinoline is soluble in organic solvents such as ethanol and ether but has limited solubility in water. The presence of the nitrogen atom in its structure contributes to its basicity and potential reactivity in chemical reactions, including hydrogenation and electrophilic substitution. Additionally, it has been studied for its biological activities, including potential neuroprotective effects. As with many organic compounds, appropriate safety measures should be taken when handling it, as it may pose health risks if ingested or inhaled.
Formula:C9H11N
InChI:InChI=1S/C9H11N/c1-2-6-9-8(4-1)5-3-7-10-9/h3,5,7H,1-2,4,6H2
InChI key:InChIKey=YQDGQEKUTLYWJU-UHFFFAOYSA-N
SMILES:N=1C=CC=C2C1CCCC2
- Synonyms:
- 2,3-Cyclohexano Pyridine
- 2,3-Cyclohexeno Pyridine
- 2,3-Cyclohexenopyridine
- NSC 241127
- Quinoline, 5,6,7,8-tetrahydro-
