CAS 105211-78-7: 4-HYDROXY-3-PROPYLBENZOIC ACID METHYL ESTER
Description:4-Hydroxy-3-propylbenzoic acid methyl ester, with the CAS number 105211-78-7, is an organic compound characterized by its ester functional group derived from a benzoic acid. This compound features a propyl group and a hydroxyl group attached to the benzene ring, which contributes to its unique chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the hydroxyl group imparts some degree of polarity, influencing its solubility in various solvents. This compound is often used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals, agrochemicals, or other fine chemicals. Its reactivity can be attributed to the functional groups present, allowing for various chemical transformations. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, 4-hydroxy-3-propylbenzoic acid methyl ester is a versatile compound with applications in multiple chemical domains.
Formula:C11H14O3
InChI:InChI=1/C11H14O3/c1-3-4-8-7-9(11(13)14-2)5-6-10(8)12/h5-7,12H,3-4H2,1-2H3
- Synonyms:
- 4-Hydroxy-3-propylbenzoicacidmethylester95%
- 4-Hydroxy-3-Propylbenzoic Acid Methyl Ester 95%
- Methyl 4-Hydroxy-3-Propylbenzoate
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Methyl 4-hydroxy-3-propylbenzoate REF: IN-DA0085ALCAS: 105211-78-7 | 95% | To inquire | Thu 27 Mar 25 |
![]() | 4-Hydroxy-3-propylbenzoic acid methyl ester REF: 54-OR913101CAS: 105211-78-7 | 95% | To inquire | Thu 03 Apr 25 |
![]() | Methyl 4-hydroxy-3-propylbenzoate REF: 10-F076650CAS: 105211-78-7 | 95.0% | To inquire | Tue 08 Apr 25 |
![]() | Methyl 4-hydroxy-3-propylbenzoate REF: 3D-FM133679CAS: 105211-78-7 | Min. 95% | - - - | Discontinued product |

Ref: IN-DA0085AL
Undefined size | To inquire |

Ref: 54-OR913101
Undefined size | To inquire |

Methyl 4-hydroxy-3-propylbenzoate
Ref: 10-F076650
1g | To inquire | ||
5g | To inquire | ||
10g | To inquire |

Methyl 4-hydroxy-3-propylbenzoate
Ref: 3D-FM133679
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
5g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |